|
|
| | 4-Hydroxy-6-methylpyrimidine Basic information |
| | 4-Hydroxy-6-methylpyrimidine Chemical Properties |
| Melting point | 145-150℃ | | Boiling point | 192.1±23.0 °C(Predicted) | | density | 1.22±0.1 g/cm3(Predicted) | | RTECS | UW7528000 | | storage temp. | Sealed in dry,Room Temperature | | pka | 9.46±0.40(Predicted) | | form | Solid | | color | White to brown | | InChI | InChI=1S/C5H6N2O/c1-4-2-5(8)7-3-6-4/h2-3H,1H3,(H,6,7,8) | | InChIKey | LHRIUKSRPHFASO-UHFFFAOYSA-N | | SMILES | C1=NC(C)=CC(=O)N1 | | NIST Chemistry Reference | 6-Methyl-4-pyrimidinol(3524-87-6) | | EPA Substance Registry System | 6-Methyl-4(1H)-pyrimidinone (3524-87-6) |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | 4-Hydroxy-6-methylpyrimidine Usage And Synthesis |
| Uses | 6-Methyl-4-hydroxypyrimidine is used in the preparation of antitumor compounds based upon adenine. Also used in the synthesis of novel purimidine, 3-cyanopyridine and m-amino-N-phenylbenzamide derrivatives as tyrosine kinase inhibitors. |
| | 4-Hydroxy-6-methylpyrimidine Preparation Products And Raw materials |
|