| Company Name: |
TCI (Shanghai) Development Co., Ltd.
|
| Tel: |
021-67121386 |
| Email: |
Sales-CN@TCIchemicals.com |
| Products Intro: |
Product Name:Rhodamine 19 Perchlorate
CAS:62669-66-3
Purity:98.0% LC&N Package:1G,5G
|
|
| | RHODAMINE 19 PERCHLORATE Basic information |
| Product Name: | RHODAMINE 19 PERCHLORATE | | Synonyms: | RHODAMINE 575;RHODAMINE 575 PERCHLORATE;RHODAMINE 19P;RHODAMINE 19 PERCHLORATE;N,N'-DIETHYL-2,7-DIMETHYLRHODAMINEPERCHLORATE;2-(6-ETHYLAMINO-3-ETHYLIMINO-2,7-DIMETHYL-3H-XANTHEN-9-YL)-BENZOIC ACID PERCHLORATE;9-(2-carboxyphenyl)-3,6-bis(ethylamino)-2,7-dimethyl-xanthyliuperchlorate;9-(2-carboxyphenyl)-3,6-bis(ethylamino)-2,7-dimethylxanthylium perchlorate | | CAS: | 62669-66-3 | | MF: | C26H27ClN2O7 | | MW: | 514.96 | | EINECS: | 263-686-2 | | Product Categories: | | | Mol File: | 62669-66-3.mol |  |
| | RHODAMINE 19 PERCHLORATE Chemical Properties |
| Melting point | >300 °C(lit.) | | density | 1.2011 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | room temp | | form | powder to crystal | | color | Orange to Brown | | λmax | >517 nm | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChIKey | WRJTXSZPMAXPRF-GVWDPOEBSA-N | | SMILES | OCl(=O)(=O)=O.CCNc1cc2OC3=CC(=N/CC)\C(C)=CC3=C(c2cc1C)c4ccccc4C(O)=O | | EPA Substance Registry System | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(ethylamino)-2,7-dimethyl-, perchlorate (62669-66-3) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 22-24/25 | | RIDADR | UN 1479 5.1/PG III | | WGK Germany | 3 | | F | 3 | | TSCA | TSCA listed | | HS Code | 3204.90.0000 | | HazardClass | 5.1 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids |
| | RHODAMINE 19 PERCHLORATE Usage And Synthesis |
| Description | Rhodamine 19 Perchlorate is a metal free organic dye for dye sensitized solar cells. | | Chemical Properties | pink-red to bordeaux crystalline powder | | Uses | Rhodamine 19 Perchlorate is a metal free organic dye for dye sensitized solar cells. It also inhibits ATpase of yeast mitochondria. |
| | RHODAMINE 19 PERCHLORATE Preparation Products And Raw materials |
|