|
|
| | 1-BOC-1,10-DIAMINODECANE Basic information |
| Product Name: | 1-BOC-1,10-DIAMINODECANE | | Synonyms: | 1,10-DIAMINODECANE, N1-BOC PROTECTED;1-BOC-1,10-DIAMINODECANE;TERT-BUTYL 10-AMINODECYLCARBAMATE;1,10-Diaminodecane, N1-BOC protected 97%;Boc-DADec;N-t-Butyloxycarbonyl-1,10-diaminodecane;Decane-1,10-diamine, N-BOC protected 97%;tert-Butyl (10-aminodec-1-yl)carbamate, 1,10-Diaminodecane, N-BOC protected | | CAS: | 216961-61-4 | | MF: | C15H32N2O2 | | MW: | 272.43 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 216961-61-4.mol |  |
| | 1-BOC-1,10-DIAMINODECANE Chemical Properties |
| Boiling point | 380.4±15.0 °C(Predicted) | | density | 0.932±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 12.94±0.46(Predicted) | | form | solid | | color | Yellow | | InChI | InChI=1S/C15H32N2O2/c1-15(2,3)19-14(18)17-13-11-9-7-5-4-6-8-10-12-16/h4-13,16H2,1-3H3,(H,17,18) | | InChIKey | RSAPJHYIFKJREV-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCCCCCCCCCN |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2924190090 |
| | 1-BOC-1,10-DIAMINODECANE Usage And Synthesis |
| Description | tert-Butyl (10-aminodecyl)carbamate can be used as a PROTAC linker in the synthesis of PROTACs and other conjugation applications. tert-Butyl (10-aminodecyl)carbamate is an alkane chain with terminal amine and Boc-protected amino groups. Amine group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The Boc group can be deprotected under mild acidic conditions to form the free amine. | | Uses | tert-Butyl (10-aminodecyl)carbamate (1-Boc-1,10-diaminodecane) can be used as a PROTAC linker in the synthesis of PROTACs and other conjugation applications. tert-Butyl (10-aminodecyl)carbamate is an alkane chain with terminal amine and Boc-protected amino groups. Amine group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The Boc group can be deprotected under mild acidic conditions to form the free amine. |
| | 1-BOC-1,10-DIAMINODECANE Preparation Products And Raw materials |
|