|
|
| | 1,2-Bis(diphenylphosphino)ethane nickel(II) chloride Basic information |
| | 1,2-Bis(diphenylphosphino)ethane nickel(II) chloride Chemical Properties |
| Melting point | 263-265 °C(lit.) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform, Methanol (Sparingly) | | form | crystal | | color | orange | | Water Solubility | insoluble | | Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.015 mg/m3 | | Stability: | Hygroscopic | | InChI | InChI=1S/C26H24P2.2ClH.Ni/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;;;/h1-20H,21-22H2;2*1H;/q;;;+2/p-2 | | InChIKey | XXECWTBMGGXMKP-UHFFFAOYSA-L | | SMILES | [Ni+2].C(P(C1=CC=CC=C1)C1=CC=CC=C1)CP(C1=CC=CC=C1)C1=CC=CC=C1.[Cl-].[Cl-] | | CAS DataBase Reference | 14647-23-5(CAS DataBase Reference) |
| Hazard Codes | T,Xn | | Risk Statements | 45-20/21/22-36/37/38-42/43-40 | | Safety Statements | 53-22-26-36-45-52 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29319090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 1B Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 STOT SE 3 |
| | 1,2-Bis(diphenylphosphino)ethane nickel(II) chloride Usage And Synthesis |
| Chemical Properties | Orange to red crystalline powder | | Uses | suzuki reaction | | Uses | Dichloro[bis(1,2-diphenylphosphino)ethane]nickel(II) is a reactant involved in Kumada catalyst-transfer polycondensation, oxidation of carboranyl phosphine ligands, synthesis of nickel-iron dithiolato hydrides, Ullmann reactions - homocoupling reactions, co-catalyst for hydroformylation of alcohols for the synthesis of quaternary carbon centers, catalyst for Wacker-type intramolecular aerobic oxidative amination of alkenes. | | reaction suitability | core: nickel reagent type: catalyst |
| | 1,2-Bis(diphenylphosphino)ethane nickel(II) chloride Preparation Products And Raw materials |
|