- Boc-D-Phe(4-NO2)-OH
-
- $0.00/ kg
-
2026-04-21
- CAS:61280-75-9
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- BOC-D-4-Nitrophe
-
- $20.00 / 1KG
-
2019-07-06
- CAS:61280-75-9
- Min. Order: 10KG
- Purity: 98%
- Supply Ability: 100kg
|
| | BOC-D-4-Nitrophe Basic information |
| | BOC-D-4-Nitrophe Chemical Properties |
| Melting point | 120°C | | alpha | -8 º (c=1,MeOH) | | Boiling point | 509.3±45.0 °C(Predicted) | | density | 1.290±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | pka | 3.70±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow | | BRN | 4203814 | | Major Application | peptide synthesis | | InChI | 1S/C14H18N2O6/c1-14(2,3)22-13(19)15-11(12(17)18)8-9-4-6-10(7-5-9)16(20)21/h4-7,11H,8H2,1-3H3,(H,15,19)(H,17,18)/t11-/m1/s1 | | InChIKey | XBQADBXCNQPHHY-LLVKDONJSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccc(cc1)[N+]([O-])=O)C(O)=O | | CAS DataBase Reference | 61280-75-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | F | 8 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | BOC-D-4-Nitrophe Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N-Boc-p-nitro-D-phenylalanine is the N-Boc protected form of p-Nitro-D-phenylalanine (N502720). Also a useful synthetic intermediate in the synthesis of (R)-Hydroxymelphalan (H393845, TFA salt); an analog of Melphalan (M216900) which is an antineoplastic. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-D-4-Nitrophe Preparation Products And Raw materials |
|