|
|
| | Fmoc-L-beta-homoisoleucine Basic information |
| | Fmoc-L-beta-homoisoleucine Chemical Properties |
| Melting point | 98-100 °C(Solv: hexane (110-54-3); ethyl acetate (141-78-6)) | | Boiling point | 572.1±33.0 °C(Predicted) | | density | 1.188±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 4.41±0.10(Predicted) | | form | Powder | | color | white | | BRN | 7980987 | | Major Application | peptide synthesis | | InChI | 1S/C22H25NO4/c1-3-14(2)20(12-21(24)25)23-22(26)27-13-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,14,19-20H,3,12-13H2,1-2H3,(H,23,26)(H,24,25)/t14-,20+/m0/s1 | | InChIKey | VHZUUIWBAYOCDD-JLTOFOAXSA-N | | SMILES | CC[C@H](C)[C@@H](CC(O)=O)NC(=O)OCC1c2ccccc2-c3ccccc13 | | CAS DataBase Reference | 193954-27-7(CAS DataBase Reference) |
| WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | Fmoc-L-beta-homoisoleucine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-l-beta-homoisoleucine | | General Description | may contain ~8% (w/w) ethyl acetate | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-L-beta-homoisoleucine Preparation Products And Raw materials |
|