|
|
| | 4,4'-DIBROMOTRIPHENYLAMINE Basic information |
| Product Name: | 4,4'-DIBROMOTRIPHENYLAMINE | | Synonyms: | N,N-BIS(P-BROMOPHENYL)ANILINE;Dibromotriphenylamine;4,4''-DIBROMOTRIPHENYLAMINE 98+%;N,N-Bis(4-bromophenyl)aniline;4,4'-(Phenylimino)bis(1-bromobenzene);Bis(4-bromophenyl)phenylamine;Phenylbis(4-bromophenyl)amine;N,N-Diphenyl-4,4'-dibromoaniline | | CAS: | 81090-53-1 | | MF: | C18H13Br2N | | MW: | 403.11 | | EINECS: | 628-703-3 | | Product Categories: | OLED materials,pharm chemical,electronic;Acid Anhydrides, etc. (Reagents for Conducting Polymer Research);Electroluminescence;Fluorenes, etc. (reagent for high-performance polymer research);Functional Materials;Reagent for High-Performance Polymer Research;Reagents for Conducting Polymer Research | | Mol File: | 81090-53-1.mol |  |
| | 4,4'-DIBROMOTRIPHENYLAMINE Chemical Properties |
| Melting point | 69°C | | Boiling point | 470.7±30.0 °C(Predicted) | | density | 1.593 | | Fp | 110 °C | | storage temp. | Inert atmosphere,Room Temperature | | pka | -4.29±0.50(Predicted) | | form | Solid | | color | Off-white | | InChI | InChI=1S/C18H13Br2N/c19-14-6-10-17(11-7-14)21(16-4-2-1-3-5-16)18-12-8-15(20)9-13-18/h1-13H | | InChIKey | KIGVOJUDEQXKII-UHFFFAOYSA-N | | SMILES | C1(N(C2=CC=C(Br)C=C2)C2=CC=CC=C2)=CC=C(Br)C=C1 |
| | 4,4'-DIBROMOTRIPHENYLAMINE Usage And Synthesis |
| Uses | Polytriarylamine Semiconductors | | Synthesis | Step 1: Synthesis of 4,4'-dibromotriphenylamine
1. 12 g (50 mmol) of triphenylamine was dissolved in 250 mL of ethyl acetate in a 500 mL conical flask.
2. 18 g (100 mmol) of N-bromosuccinimide (NBS) was added to the above solution.
3. The reaction mixture was stirred at room temperature for 24 hours.
4. Upon completion of the reaction, the reaction mixture was washed with deionized water.
5. The mixture was dried by adding anhydrous magnesium sulfate to remove water.
6. The desiccant was removed by filtration and the filtrate was concentrated. 7.
7. 20 g of white solid product was obtained after drying in 99% yield. | | References | [1] Patent: WO2009/72587, 2009, A1. Location in patent: Page/Page column 191
[2] Patent: WO2009/139358, 2009, A1. Location in patent: Page/Page column 90
[3] Journal of Materials Chemistry C, 2016, vol. 4, # 13, p. 2579 - 2586
[4] Journal of Materials Chemistry C, 2016, vol. 4, # 43, p. 10301 - 10308
[5] Journal of Materials Chemistry, 2012, vol. 22, # 23, p. 11629 - 11635 |
| | 4,4'-DIBROMOTRIPHENYLAMINE Preparation Products And Raw materials |
|