|
|
| | 4-Bromo-1-chloroisoquinoline Basic information |
| | 4-Bromo-1-chloroisoquinoline Chemical Properties |
| Melting point | 97 °C (decomp) | | Boiling point | 328.8±22.0 °C(Predicted) | | density | 1.673±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -0.02±0.31(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H5BrClN/c10-8-5-12-9(11)7-4-2-1-3-6(7)8/h1-5H | | InChIKey | HRWILRGBDZGABZ-UHFFFAOYSA-N | | SMILES | C1(Cl)C2=C(C=CC=C2)C(Br)=CN=1 | | CAS DataBase Reference | 66728-98-1(CAS DataBase Reference) |
| | 4-Bromo-1-chloroisoquinoline Usage And Synthesis |
| Uses | 4-Bromo-1-chloroisoquinoline is an isoquinoline derivative whose molecular structure contains substituents chlorine and bromine atoms at positions 1 and 4. The product can be used in metal-catalysed cross-coupling reactions and in the preparation of pharmaceuticals. | | Synthesis | The general procedure for the synthesis of 4-bromo-1-chloroisoquinolines from 4-bromo-1(2H)-isoquinolinones was as follows: 4-bromoisoquinolin-1-ol (1.4 g, 5.80 mmol) was mixed with phosphorus trichloride (POCl3, 8.9 g, 58.09 mmol, 10 equiv.) and heated to reflux under stirring conditions. The progress of the reaction was monitored by liquid chromatography-mass spectrometry (LCMS) and it was confirmed that the reaction was completed after 4 hours. The reaction mixture was cooled to room temperature and the reaction was quenched with ice water (100 mL) followed by extraction with ethyl acetate (EtOAc, 3 x 25 mL). The organic phases were combined and washed sequentially with water (3 × 20 mL), saturated aqueous sodium bicarbonate (30 mL) and brine (20 mL). The organic layer was dried with anhydrous sodium sulfate and concentrated under reduced pressure to remove the solvent to afford 4-bromo-1-chloroisoquinoline as a white solid 1.3 g in 87% yield. | | References | [1] Bioorganic and Medicinal Chemistry Letters, 2017, vol. 27, # 2, p. 217 - 222 |
| | 4-Bromo-1-chloroisoquinoline Preparation Products And Raw materials |
|