| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:8-Bromoadenosine 5'-monophosphate CAS:23567-96-6 Purity:>=98% Package:25MG Remarks:B3131-25MG
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
| Products Intro: |
Product Name:8-Bromo-AMP CAS:23567-96-6 Purity:95% by HPLC
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:8-Bromoadenosine 5'-monophosphate >=98% CAS:23567-96-6 Purity:NULL Package:25mg Remarks:NULL
|
|
| | 8-BROMOADENOSINE 5'-MONOPHOSPHATE Basic information |
| | 8-BROMOADENOSINE 5'-MONOPHOSPHATE Chemical Properties |
| storage temp. | -20°C | | solubility | water: 100 mg/mL, clear, colorless | | form | Solid | | color | White to off-white | | biological source | synthetic (organic) | | Water Solubility | water: 100mg/mL, clear, colorless | | InChI | 1S/C10H13BrN5O7P/c11-10-15-4-7(12)13-2-14-8(4)16(10)9-6(18)5(17)3(23-9)1-22-24(19,20)21/h2-3,5-6,9,17-18H,1H2,(H2,12,13,14)(H2,19,20,21) | | InChIKey | DNPIJKNXFSPNNY-UHFFFAOYSA-N | | SMILES | Nc1ncnc2n(C3OC(COP(O)(O)=O)C(O)C3O)c(Br)nc12 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 8-BROMOADENOSINE 5'-MONOPHOSPHATE Usage And Synthesis |
| Uses | 8-Bromoadenosine 5′′-monophosphate (8-Br-AMP) is an analogue of 5′-AMP useful for receptor mapping studies; as a starting structure for 8-modified 5′-AMP derivatives and for synthesis of poly-8-bromoriboadenylic acid. |
| | 8-BROMOADENOSINE 5'-MONOPHOSPHATE Preparation Products And Raw materials |
|