- Ethyl bromofluoroacetate
-
- $15.00 / 1KG
-
2021-07-02
- CAS:401-55-8
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Ethyl bromofluoroacetate Basic information |
| | Ethyl bromofluoroacetate Chemical Properties |
| Boiling point | 154 °C (lit.) | | density | 1.565 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.424(lit.) | | Fp | 159 °F | | storage temp. | 2-8°C | | form | Liquid | | Specific Gravity | 1.5407 | | color | Clear yellow | | Water Solubility | It is soluble in water. | | InChI | InChI=1S/C4H6BrFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3 | | InChIKey | ULNDTPIRBQGESN-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(Br)F | | CAS DataBase Reference | 401-55-8(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36-36/37/39 | | RIDADR | UN2810 | | WGK Germany | 3 | | Hazard Note | Harmful/Irritant | | TSCA | T | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29159000 |
| | Ethyl bromofluoroacetate Usage And Synthesis |
| Chemical Properties | Ethyl bromofluoroacetate is clear yellow liquid | | Uses | Ethyl bromofluoroacetate is an intermediate useful for the synthesis of polyfluoroalkyl-substituted fluoro enol ethers1 and N-protected α-fluoroglycines.2 | | Uses | Ethyl bromofluoroacetate is used as an intermediate useful in the synthesis of polyfluoroalkyl-substituted fluoro enol ethers and N-protected α-fluoroglycines. |
| | Ethyl bromofluoroacetate Preparation Products And Raw materials |
|