4-PHENYL-1H-PYRAZOL-3-YLAMINE manufacturers
|
| | 4-PHENYL-1H-PYRAZOL-3-YLAMINE Basic information |
| Product Name: | 4-PHENYL-1H-PYRAZOL-3-YLAMINE | | Synonyms: | Pyrazole, 3-amino-4-phenyl-;SMR000309623;ZINC00169443;ZINC04234984;3(or5)-amino-4-phenyl-pyrazol;3-amino-4-phenyl-pyrazol;JR-8754, 3-Amino-4-phenylpyrazole, 97%;4-phenyl-1h-pyrazol-4-amin | | CAS: | 5591-70-8 | | MF: | C9H9N3 | | MW: | 159.19 | | EINECS: | | | Product Categories: | | | Mol File: | 5591-70-8.mol |  |
| | 4-PHENYL-1H-PYRAZOL-3-YLAMINE Chemical Properties |
| Melting point | 170-173℃ | | Boiling point | 394.4±30.0 °C(Predicted) | | density | 1.238±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 15.22±0.50(Predicted) | | form | solid | | color | Beige | | InChI | InChI=1S/C9H9N3/c10-9-8(6-11-12-9)7-4-2-1-3-5-7/h1-6H,(H3,10,11,12) | | InChIKey | QEHKQNYBBLCFIJ-UHFFFAOYSA-N | | SMILES | N1C=C(C2=CC=CC=C2)C(N)=N1 |
| Hazard Codes | C,Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-PHENYL-1H-PYRAZOL-3-YLAMINE Usage And Synthesis |
| | 4-PHENYL-1H-PYRAZOL-3-YLAMINE Preparation Products And Raw materials |
|