|
| METHYL 3,5-DIFLUOROBENZOATE Basic information |
| METHYL 3,5-DIFLUOROBENZOATE Chemical Properties |
Melting point | 23-27 °C(lit.) | Boiling point | 187-189 °C(lit.) | density | 1.265 g/mL at 25 °C(lit.) | refractive index | n20/D 1.4740(lit.) | Fp | 170 °C | storage temp. | Room temperature. | form | liquid | color | Clear, colourless | InChI | InChI=1S/C8H6F2O2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3 | InChIKey | JBEJPGWPXIIQBB-UHFFFAOYSA-N | SMILES | C1(C=C(C(=O)OC)C=C(F)C=1)F | CAS DataBase Reference | 216393-55-4(CAS DataBase Reference) |
Hazard Codes | Xn,Xi | Risk Statements | 22 | Safety Statements | 36 | WGK Germany | 3 | Hazard Note | Irritant | HS Code | 2916310090 |
| METHYL 3,5-DIFLUOROBENZOATE Usage And Synthesis |
| METHYL 3,5-DIFLUOROBENZOATE Preparation Products And Raw materials |
|