|
|
| | METHYL 3,5-DIFLUOROBENZOATE Basic information | | Uses |
| | METHYL 3,5-DIFLUOROBENZOATE Chemical Properties |
| Melting point | 23-27 °C(lit.) | | Boiling point | 187-189 °C(lit.) | | density | 1.265 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4740(lit.) | | Fp | 170 °C | | storage temp. | Room temperature. | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C8H6F2O2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3 | | InChIKey | JBEJPGWPXIIQBB-UHFFFAOYSA-N | | SMILES | C1(C=C(C(=O)OC)C=C(F)C=1)F | | CAS DataBase Reference | 216393-55-4(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2916310090 |
| | METHYL 3,5-DIFLUOROBENZOATE Usage And Synthesis |
| Uses | Methyl 3,5-difluorobenzoate is a white crystalline solid that can be used as an intermediate in the synthesis of ecdysone-based insecticides such as methoxyfenozide and acetamiprid; it can also improve the curing speed of polyurethane and shorten the demolding time; and it can also be used in the synthesis of flame retardants. |
| | METHYL 3,5-DIFLUOROBENZOATE Preparation Products And Raw materials |
|