- HOMOERIODICTYOL
-
- $1.00
-
2026-08-07
- CAS:446-71-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20000KG
- Homoeriodictyol
-
- $129.00
-
2026-07-15
- CAS:446-71-9
- Purity: 99.89%
- Supply Ability: 10g
- homoeriodictyol
-
- $1.00
-
2019-07-06
- CAS:446-71-9
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100KG
|
| | HOMOERIODICTYOL Basic information |
| Product Name: | HOMOERIODICTYOL | | Synonyms: | (S)-2,3-Dihydro-4',5,7-trihydroxy-3'-methoxyflavone;(2S)-5,7-dihydroxy-2-(4-hydroxy-3-methoxy-phenyl)-2,3-dihydrochromen-4-one;(2S)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydrochromen-4-one;(2S)-5,7-dihydroxy-2-(4-hydroxy-3-methoxy-phenyl)chroman-4-one;3'-METHOXY-5,7,4'-TRIHYDROXYFLAVANONE;ERIODICTYONONE;(S)-2,3-dihydro-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-benzopyrone;HOMOERIODICTYOL hplc | | CAS: | 446-71-9 | | MF: | C16H14O6 | | MW: | 302.28 | | EINECS: | 207-173-3 | | Product Categories: | Flavanones | | Mol File: | 446-71-9.mol |  |
| | HOMOERIODICTYOL Chemical Properties |
| Melting point | 225-227°C (dec.) | | alpha | D20 -28° (alc) | | Boiling point | 583.8±50.0 °C(Predicted) | | density | 1.458±0.06 g/cm3(Predicted) | | pka | 7.49±0.40(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C16H14O6/c1-21-14-4-8(2-3-10(14)18)13-7-12(20)16-11(19)5-9(17)6-15(16)22-13/h2-6,13,17-19H,7H2,1H3/t13-/m0/s1 | | InChIKey | FTODBIPDTXRIGS-ZDUSSCGKSA-N | | SMILES | [C@H]1(C2=CC=C(O)C(OC)=C2)OC2=CC(O)=CC(O)=C2C(=O)C1 | | LogP | 2.720 (est) |
| | HOMOERIODICTYOL Usage And Synthesis |
| Uses | Benzofenap (Standard) is the analytical standard of Benzofenap. This product is intended for research and analytical applications. Benzofenap is a herbicide. | | Definition | ChEBI: A trihydroxyflavanone that consists of 3'-methoxyflavanone in which the three hydroxy substituents are located at positions 4', 5, and 7. |
| | HOMOERIODICTYOL Preparation Products And Raw materials |
|