|
|
| | (1R)-(+)-CAMPHANIC ACID Basic information |
| Product Name: | (1R)-(+)-CAMPHANIC ACID | | Synonyms: | (1R)-(+)-CAMPHANIC ACID;(1R)-3-OXO-4,7,7-TRIMETHYL-2-OXABICYCLO[2.2.1]HEPTANE-1-CARBOXYLIC ACID;2-Oxabicyclo2.2.1heptane-1-carboxylic acid, 4,7,7-trimethyl-3-oxo-, (1R,4S)-;D-(1S,3R)-(-)-CAMPHORIC ACID;(1R)-4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid, (1R)-3-Oxo-4,7,7-trimethyl-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid;(1R)-4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid;(1S,4R)-1,7,7-trimethyl-2-oxo-3-oxabicyclo[2.2.1]heptane-4-carboxylic acid;(1S,4R)-2-keto-1,7,7-trimethyl-3-oxabicyclo[2.2.1]heptane-4-carboxylic acid | | CAS: | 67111-66-4 | | MF: | C10H14O4 | | MW: | 198.22 | | EINECS: | | | Product Categories: | Chiral Compound | | Mol File: | 67111-66-4.mol |  |
| | (1R)-(+)-CAMPHANIC ACID Chemical Properties |
| Melting point | 200-202 °C(lit.) | | Boiling point | 355.5±25.0 °C(Predicted) | | density | 1.296±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.36±0.60(Predicted) | | Optical Rotation | [α]20/D +19°, c =1 in dioxane | | InChI | 1S/C10H14O4/c1-8(2)9(3)4-5-10(8,6(11)12)14-7(9)13/h4-5H2,1-3H3,(H,11,12)/t9-,10+/m1/s1 | | InChIKey | KPWKPGFLZGMMFX-ZJUUUORDSA-N | | SMILES | CC1(C)[C@]2(C)CC[C@]1(OC2=O)C(O)=O | | CAS DataBase Reference | 67111-66-4(CAS DataBase Reference) |
| | (1R)-(+)-CAMPHANIC ACID Usage And Synthesis |
| Uses | Chiral auxiliary in the synthesis of azasugars. |
| | (1R)-(+)-CAMPHANIC ACID Preparation Products And Raw materials |
|