| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 1-BROMOANTHRAQUINONE
-
- $25.00
-
2026-03-20
- CAS:632-83-7
- Min. Order: 100ASSAYS
- Purity: 99.5%
- Supply Ability: 100 mt
|
| | 1-Bromoanthraquinone Basic information |
| | 1-Bromoanthraquinone Chemical Properties |
| Melting point | 191 °C | | Boiling point | 444.9±34.0 °C(Predicted) | | density | 1.5425 (rough estimate) | | refractive index | 1.4650 (estimate) | | form | powder to crystal | | color | White to Yellow to Orange | | InChI | InChI=1S/C14H7BrO2/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7H | | InChIKey | CXTPIHZYOGDSLV-UHFFFAOYSA-N | | SMILES | C1(Br)=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1 |
| | 1-Bromoanthraquinone Usage And Synthesis |
| | 1-Bromoanthraquinone Preparation Products And Raw materials |
|