|
|
| | 3-Methyl-d3-adenine Basic information |
| | 3-Methyl-d3-adenine Chemical Properties |
| Melting point | 310-312°C | | Boiling point | 240.096±50.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.607±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 6.774±0.20(predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | 1S/C6H7N5/c1-11-3-10-5(7)4-6(11)9-2-8-4/h2-3H,7H2,1H3/i1D3 | | InChIKey | FSASIHFSFGAIJM-FIBGUPNXSA-N | | SMILES | NC(N=CN1C([2H])([2H])[2H])=C2C1=NC=N2 | | CAS Number Unlabeled | 5142-23-4 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-Methyl-d3-adenine Usage And Synthesis |
| Chemical Properties | 3-METHYL-D3-ADENINE is White Crystalline Solid | | Uses | Labelled 3-Methyl Adenine (M275904). 3-MA inhibits autophagy by blocking autophagosome formation via the inhibition of type III Phosphatidylinositol 3-kinases (PI-3K). For use as an autophagy inhibito
r, 3-MA is typically used at a concentration of 5 mM. | | Uses | 3-Methyl Adenine-d3 is labelled 3-Methyl Adenine (M275904). 3-Methyl Adenine is a selective autophagy and phosphoinositide 3-kinase (PI3K) inhibitor (1,2,3). 3-MA inhibits autophagy by blocking autophagosome formation via the inhibition of type III Phosphatidylinositol 3-kinases (PI-3K). |
| | 3-Methyl-d3-adenine Preparation Products And Raw materials |
|