| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,4-DIMETHOXY-4'-HYDROXYBENZOPHENONE Basic information |
| | 2,4-DIMETHOXY-4'-HYDROXYBENZOPHENONE Chemical Properties |
| Melting point | 138-142 °C (lit.) | | Boiling point | 467.9±45.0 °C(Predicted) | | density | 1.206±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | soluble in Methanol | | pka | 7.73±0.15(Predicted) | | form | Powder | | color | Off-white to white | | BRN | 2508320 | | InChI | 1S/C15H14O4/c1-18-12-7-8-13(14(9-12)19-2)15(17)10-3-5-11(16)6-4-10/h3-9,16H,1-2H3 | | InChIKey | QEHRETCJMLQPCR-UHFFFAOYSA-N | | SMILES | COc1ccc(C(=O)c2ccc(O)cc2)c(OC)c1 | | CAS DataBase Reference | 41351-30-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29145090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,4-DIMETHOXY-4'-HYDROXYBENZOPHENONE Usage And Synthesis |
| Chemical Properties | 2,4-DIMETHOXY-4'-HYDROXYBENZOPHENONE is white to off-white powder | | Uses | 2,4-DIMETHOXY-4'-HYDROXYBENZOPHENONE is used for solid-phase peptide synthesis with FMOC strategy | | Preparation | Preparation by Friedel–Crafts acylation of resorcinol dimethyl ether with p-hydroxybenzoic acid, in the presence of zinc chloride and phosphorous oxychloride at 60–65° for 1.5 h (71%) or in nitrobenzene at 60° for 2–3 h; in the presence of polyphosphoric acid. | | reaction suitability | reagent type: cross-linking reagent |
| | 2,4-DIMETHOXY-4'-HYDROXYBENZOPHENONE Preparation Products And Raw materials |
|