- (Z)-11-HEXADECEN-1-YL ACETATE
-
- $35.00 / 1kg
-
2024-03-29
- CAS:34010-21-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | (Z)-11-HEXADECEN-1-YL ACETATE Basic information |
| Product Name: | (Z)-11-HEXADECEN-1-YL ACETATE | | Synonyms: | (Z)-11-HEXADECEN-1-YL ACETATE;(11Z)-11-Hexadecenyl acetate;(z)-11-hexadecenylacetate;(z)-13-octadecenyl;(z)-13-octadecenylacetate;11-Hexadecen-1-ol, acetate, (Z)-;11-Hexadecen-1-ol, 1-acetate, (11Z)-;11-Hexadecen-1-ol, acetate, (11Z)- | | CAS: | 34010-21-4 | | MF: | C18H34O2 | | MW: | 282.46 | | EINECS: | 251-791-6 | | Product Categories: | insect pheromone | | Mol File: | 34010-21-4.mol |  |
| | (Z)-11-HEXADECEN-1-YL ACETATE Chemical Properties |
| Boiling point | 348.7±11.0℃ (760 Torr) | | density | 0.875±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.4532 (20℃) | | Fp | 88.3±17.6℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly) | | form | Oil | | color | Colourless to Pale Yellow | | InChI | InChI=1S/C18H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h6-7H,3-5,8-17H2,1-2H3/b7-6- | | InChIKey | BTKXLQSCEOHKTF-SREVYHEPSA-N | | SMILES | C(OC(=O)C)CCCCCCCCC/C=C\CCCC | | LogP | 7.509 (est) | | EPA Substance Registry System | (Z)-11-Hexadecen-1-ol acetate (34010-21-4) |
| | (Z)-11-HEXADECEN-1-YL ACETATE Usage And Synthesis |
| Uses | (Z)-11-Hexadecen-1-ol Acetate can be used to synthesize sex attractant compounds for insects such as Plutella Xylostella. |
| | (Z)-11-HEXADECEN-1-YL ACETATE Preparation Products And Raw materials |
|