|
| 4-Bromo-2-fluorobenzonitrile Basic information |
| 4-Bromo-2-fluorobenzonitrile Chemical Properties |
Melting point | 69-72 °C | Boiling point | 238-239°C | density | 1.7286 (rough estimate) | refractive index | 1.5320 (estimate) | Fp | 238-239°C | storage temp. | Sealed in dry,Room Temperature | solubility | soluble in Methanol | form | Crystalline Powder or Chunks | color | White to light brown | Water Solubility | insoluble | BRN | 4231143 | InChI | InChI=1S/C7H3BrFN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H | InChIKey | HGXWRDPQFZKOLZ-UHFFFAOYSA-N | SMILES | C(#N)C1=CC=C(Br)C=C1F | CAS DataBase Reference | 105942-08-3(CAS DataBase Reference) |
| 4-Bromo-2-fluorobenzonitrile Usage And Synthesis |
Chemical Properties | white to light yellow crystal powder | Uses | 4-Bromo-2-fluorobenzonitrile is used as a OLED intermediate, Pharmaceutical, electronic and chemical intermediate. It is used in the synthesis of heterocycles and liquid crystals. |
| 4-Bromo-2-fluorobenzonitrile Preparation Products And Raw materials |
|