|
|
| | (1R,2R)-(+)-1,2-Diphenylethylenediamine Basic information |
| Product Name: | (1R,2R)-(+)-1,2-Diphenylethylenediamine | | Synonyms: | (R,R)-(+)-1,2-DIPHENYLETHYLENEDIAMINE;(1R,2R)-(+)-1,2-Diphenyl-1,2-ethanediamine ee;(1S,2S)-1,2-Diphenyl-1,2-diaminoethane;(αS,βS)-Bibenzyl-α,β-diamine;(1R,2R)-(+)-1,2-Diphenyl-1,2-ethanediamine ,98% [99%,e.e.];(1R,2R)-(+)-1,2-Diphenylethylenediamine ,99% [ee:99%];(1R,2R)-Diphenyl-1,2-ethanediamine;(1R,2R)-(+)-1,2-Diphenyl-1,2-ethanediamine, 98+%, ee 98% | | CAS: | 35132-20-8 | | MF: | C14H16N2 | | MW: | 212.29 | | EINECS: | 609-071-8 | | Product Categories: | Chiral Nitrogen;DPEN Series;CHIRAL COMPOUNDS;chiral;Chiral reagent;organic amine;Aromatics;Chiral Reagents;Miscellaneous Reagents;Amines (Chiral);Analytical Chemistry;Asymmetric Synthesis;Chiral Building Blocks;e.e. / Absolute Configuration Determination (NMR);Enantiomer Excess & Absolute Configuration Determination;Synthetic Organic Chemistry;Amines and Derivatives;CHIRAL CHEMICALS;Chiral Compound | | Mol File: | 35132-20-8.mol |  |
| | (1R,2R)-(+)-1,2-Diphenylethylenediamine Chemical Properties |
| Melting point | 79-83 °C(lit.) | | alpha | 104 º (c=1.1, MeOH 25 ºC) | | Boiling point | 342.14°C (rough estimate) | | density | 1.0799 (rough estimate) | | refractive index | 103 ° (C=1, EtOH) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 9.78±0.10(Predicted) | | form | Crystalline Powder | | color | White to light yellow | | Optical Rotation | [α]20/D +102°, c = 1 in ethanol | | Water Solubility | Insoluble in water. | | Sensitive | Air Sensitive | | BRN | 2369988 | | Stability: | Hygroscopic | | InChI | 1S/C14H16N2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H,15-16H2/t13-,14-/m1/s1 | | InChIKey | PONXTPCRRASWKW-ZIAGYGMSSA-N | | SMILES | N[C@@H]([C@H](N)c1ccccc1)c2ccccc2 | | CAS DataBase Reference | 35132-20-8(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-23 | | HazardClass | 8 | | HS Code | 29212900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (1R,2R)-(+)-1,2-Diphenylethylenediamine Usage And Synthesis |
| Description | (1R,2R)-(+)-1,2-Diphenylethylenediamine is a chiral reagent widely used in the chemical industry at present, used for asymmetric synthesis and optical resolution. | | Chemical Properties | white to light yellow crystal powder | | Uses | (1R,2R)-(+)-1,2-Diphenyl-1,2-ethanediamine is used as chiral solvation agent for determination of enantiomeric excess of chiral acids by NMR. It is used in various catalyst systems for asymmetric reactions. | | Synthesis | Add 1,2-diphenylethanedione dioxime (48g, 0.20mol) and 260ml methanol in a 500ml four-necked flask equipped with a condenser, stir to dissolve all of them, and then add 2g of activated charcoal (120 mesh), 0.5g of Raney's nickel, raise the temperature to 60 , and then add 80% hydrazine hydrate (28.75g, 0.46mol) slowly dropwise, and keep the temperature of the reaction between 58 -62 , there is nitrogen emission during the reaction, and the rate of dropwise acceleration is controlled to keep the nitrogen emission rate not too fast, and liquid chromatography tracks the reaction process. -62 , the reaction process has nitrogen release, drop acceleration control in the nitrogen release rate is not too fast as well, liquid chromatography to track the reaction process, when the raw material 1,2-diphenylethanedione dioxime disappeared after the end of the reaction, cooling the mixture, filtration of Ranieri nickel and activated carbon, to a small amount of water covered with a preserved in order to prepare for sets of use, the filtrate distillation to recover the methanol, and the residue added to 200 ml of petroleum ether heated to make all dissolved, cooled for 24 hours and filtered to get the product The residue was heated by adding 200 ml of petroleum ether to dissolve all of it, then cooled and filtered for 24 hours to obtain the product (1R,2R)-1,2-diphenylethylenediamine 41.55g, yield 98%, chemical purity 99.57%. |
| | (1R,2R)-(+)-1,2-Diphenylethylenediamine Preparation Products And Raw materials |
| Raw materials | Ethanol-->Hydrochloric acid-->Acetic acid-->Sodium-->N,N-Dimethylformamide-->Acetic anhydride-->Ammonia-->Hydrogen bromide-->Sodium acetate-->Sodium ethoxide-->Benzaldehyde-->Cyclohexanone-->Lithium-->D-(-)-Tartaric Acid-->Benzil | | Preparation Products | (1R,2R)-N,N'-DI-P-TOLUENESULFONYL-1,2-DIPHENYL-1,2-ETHYLENEDIAMINE-->(1R,2R)-(+)-N,N'-DIMETHYL-1,2-DIPHENYL-1,2-ETHANE DIAMINE-->Benzenesulfonamide, N-[(1R,2R)-2-amino-1,2-diphenylethyl]-4-nitro- |
|