- (-)-ALPHA-CEDRENE
-
- $10.00 / 1ASSAYS
-
2026-03-02
- CAS:469-61-4
- Min. Order: 1ASSAYS
- Purity: 99%
- Supply Ability: 1 ton
- (-)-Cedrene
-
- $47.00 / 500mg
-
2026-01-29
- CAS:469-61-4
- Min. Order:
- Purity: 97.00%
- Supply Ability: 10g
- (-)-ALPHA-CEDRENE
-
- $0.00 / 200KG
-
2025-06-27
- CAS:469-61-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | (-)-ALPHA-CEDRENE Basic information |
| Product Name: | (-)-ALPHA-CEDRENE | | Synonyms: | 3abeta,7beta,8aalpha)]-3alph;7-methanoazulene,2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-,(3r-(3-alpha,3a-beta,7-beta,8a-alpha))1h-3;7-Methanoazulene,2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-,[3R-(3.alpha.,3a.beta.,7.beta.1H-3a;7-methanoazulene,2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-1h-3(3r-(3-alp;7-methanoazulene,2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-1h-3[3theta-(;Cedr-8-ene;levo-alpha-cedrene;(1S,2R,5S)-2,6,6,8-TETRAMETHYLTRICYCLO[5.3.1.0(1.5)]UNDEC-8-ENE | | CAS: | 469-61-4 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | 207-418-4 | | Product Categories: | Industrial/Fine Chemicals | | Mol File: | 469-61-4.mol |  |
| | (-)-ALPHA-CEDRENE Chemical Properties |
| alpha | -88 º(c=10%, EtOH) | | Boiling point | 261-262 °C(lit.) | | density | 0.932 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.498 | | Fp | 104°C | | storage temp. | 2-8°C | | solubility | Chloroform (Soluble), DMSO (Slightly, Heated), Ethanol (Very Slightly), Methanol | | form | Oil | | color | Colourless to Light Yellow | | Odor | at 100.00 %. woody cedar sweet fresh | | Odor Type | woody | | Optical Rotation | [α]20/D 88±1°, c = 10% in ethanol | | BRN | 3196861 | | Dielectric constant | 3.2（24℃） | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h7,11-13H,5-6,8-9H2,1-4H3/t11-,12+,13+,15+/m1/s1 | | InChIKey | IRAQOCYXUMOFCW-OSFYFWSMSA-N | | SMILES | C[C@@H]1CC[C@H]2C(C)(C)[C@H]3C[C@@]12CC=C3C | | LogP | 6.308 (est) | | CAS DataBase Reference | 469-61-4(CAS DataBase Reference) | | NIST Chemistry Reference | 1H-3a,7-methanoazulene, 2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-, [3r-(3«alpha»,3a«beta»,7«beta»,8a«alpha»)]-(469-61-4) | | EPA Substance Registry System | 1H-3a,7-Methanoazulene, 2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-, (3R,3aS,7S,8aS)- (469-61-4) |
| Hazard Codes | Xi,N | | Risk Statements | 36/38-50/53-50 | | Safety Statements | 26-60-61-24/25-23 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 2 | | RTECS | PB7725000 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Acute 1
Eye Irrit. 2
Skin Irrit. 2 |
| | (-)-ALPHA-CEDRENE Usage And Synthesis |
| Uses | (-)-a-Cedrene has been observed in the essential oil extract of Scutellaria barbata, which has displayed antimicrobial activity. | | Definition | ChEBI: A sesquiterpene that is cedrane which has a double bond between positions 8 and 9. |
| | (-)-ALPHA-CEDRENE Preparation Products And Raw materials |
|