- Fmoc-d-mephe-oh
-
- $0.00 / 1KG
-
2022-01-27
- CAS:138775-05-0
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 100 tons
- FMOC-N-Me-D-Phe-OH
-
- $1.00 / 1g
-
2020-01-06
- CAS:138775-05-0
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
|
| | Fmoc-N-methyl-D-phenylalanine Basic information |
| Product Name: | Fmoc-N-methyl-D-phenylalanine | | Synonyms: | N-(9-Fluorenylmethyloxycarbonyl)-N-methyl-D-phenylalanine;N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-N-ALPHA-METHYL-D-PHENYLALANINE;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-N-ALPHA-METHYL-PHENYLALANINE;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-N-ALPHA-METHYL-D-PHENYLALANINE;N-ALPHA-FMOC-N-ALPHA-METHYL-D-PHENYLALANINE;(2R)-2-[[(9H-fluoren-9-ylMethoxy)carbonyl](Methyl)aMino]-3-phenylpropanoic acid;FMOC-N-METHYL-D-PHENYLALANINE;FMOC-N-ME-D-PHE-OH | | CAS: | 138775-05-0 | | MF: | C25H23NO4 | | MW: | 401.45 | | EINECS: | 1533716-785-6 | | Product Categories: | Amino Acid Derivatives;Amino Acids | | Mol File: | 138775-05-0.mol |  |
| | Fmoc-N-methyl-D-phenylalanine Chemical Properties |
| Boiling point | 595.4±39.0 °C(Predicted) | | density | 1.260±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.78±0.10(Predicted) | | form | Solid | | color | White to off-white | | BRN | 8441627 | | Major Application | peptide synthesis | | InChI | 1S/C25H23NO4/c1-26(23(24(27)28)15-17-9-3-2-4-10-17)25(29)30-16-22-20-13-7-5-11-18(20)19-12-6-8-14-21(19)22/h2-14,22-23H,15-16H2,1H3,(H,27,28)/t23-/m1/s1 | | InChIKey | GBROUWPNYVBLFO-HSZRJFAPSA-N | | SMILES | CN([C@H](Cc1ccccc1)C(O)=O)C(=O)OCC2c3ccccc3-c4ccccc24 | | CAS DataBase Reference | 138775-05-0(CAS DataBase Reference) |
| WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-N-methyl-D-phenylalanine Usage And Synthesis |
| Chemical Properties | White to off-white solid | | Uses | Fmoc-D-MePhe-OH is an intermediate used in the preparation of fluorinated analogs of pepstatin A and grassystatin A that functions as inhibitors of aspartic protease enzymes. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-N-methyl-D-phenylalanine Preparation Products And Raw materials |
|