|
|
| | 5-BROMO-2-FLUOROPYRIMIDINE Basic information |
| Product Name: | 5-BROMO-2-FLUOROPYRIMIDINE | | Synonyms: | 5-Bromo-2-fluoropyrimidine ,97%;5-Bromo-2-fluoropyrimidne;5-BROMO-2-FLUOROPYRIMIDINE;5-Bromo-2-fluoro-1,3-diazine;5-Bromo-2-fluoropyrimidine>;5-Bromo-2-fluoropyrimidine, 97%, for synthesis;Pyrimidine, 5-bromo-2-fluoro-;5-BROMO-2-FLUOROPYRIMIDINE ISO 9001：2015 REACH | | CAS: | 62802-38-4 | | MF: | C4H2BrFN2 | | MW: | 176.97 | | EINECS: | 672-908-0 | | Product Categories: | Pyrimidine;Organohalides | | Mol File: | 62802-38-4.mol |  |
| | 5-BROMO-2-FLUOROPYRIMIDINE Chemical Properties |
| Melting point | 90-93℃ | | Boiling point | 270.8±32.0 °C(Predicted) | | density | 1.838±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | -2.90±0.22(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C4H2BrFN2/c5-3-1-7-4(6)8-2-3/h1-2H | | InChIKey | CTWZYPZCDJKBRS-UHFFFAOYSA-N | | SMILES | C1(F)=NC=C(Br)C=N1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-37 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29335990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-BROMO-2-FLUOROPYRIMIDINE Usage And Synthesis |
| Chemical Properties | White to light yellow solid | | Uses | 5-Bromo-2-fluoropyrimidine is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| | 5-BROMO-2-FLUOROPYRIMIDINE Preparation Products And Raw materials |
|