| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Methyl 3-amino-4-(4-bromophenyl)thiophene-2-carboxylate Basic information |
| Product Name: | Methyl 3-amino-4-(4-bromophenyl)thiophene-2-carboxylate | | Synonyms: | BUTTPARK 46\15-18;3-Amino-4-(4-bromo-phenyl)-thiophene-2-carboxylic acid methyl ester;JR-8063, Methyl 3-amino-4-(4-bromophenyl)thiophene-2-carboxylate, 97%;2-Thiophenecarboxylic acid, 3-amino-4-(4-bromophenyl)-, methyl ester;Methyl 3-amino-4-(4-bromophenyl)thiophene-2-carboxylate | | CAS: | 156274-31-6 | | MF: | C12H10BrNO2S | | MW: | 312.18 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Methyl 3-amino-4-(4-bromophenyl)thiophene-2-carboxylate Chemical Properties |
| Melting point | 120-121°C | | Boiling point | 425.6±45.0 °C(Predicted) | | density | 1.556±0.06 g/cm3(Predicted) | | pka | 1.42±0.17(Predicted) | | form | solid | | InChI | 1S/C12H10BrNO2S/c1-16-12(15)11-10(14)9(6-17-11)7-2-4-8(13)5-3-7/h2-6H,14H2,1H3 | | InChIKey | VRCWDZZOUSAXIH-UHFFFAOYSA-N | | SMILES | COC(C1=C(N)C(C2=CC=C(Br)C=C2)=CS1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Methyl 3-amino-4-(4-bromophenyl)thiophene-2-carboxylate Usage And Synthesis |
| | Methyl 3-amino-4-(4-bromophenyl)thiophene-2-carboxylate Preparation Products And Raw materials |
|