|
|
| | 2-Methyl-3-nitrobenzotrifluoride Basic information |
| Product Name: | 2-Methyl-3-nitrobenzotrifluoride | | Synonyms: | 3-Trifluoromethyl-2-methyl-1-nitrobenzene;2-Methyl-3-nitrobenzotrifluoride 97%;2-Methyl-3-nitrobenzotrifluoride97%;2-Methyl-3-nitrobenz;2-methyl-1-nitro-3-(trifluoromethyl)benzene;2-methyl-1-nitro-3-(trifluoromethyl)benzene,2-methyl-3-nitrobenzotrifluoride;1-(Trifluoromethyl)-2-methyl-3-nitrobenzene;2-Nitro-6-(trifluoromethyl)toluene, 2-Methyl-3-(trifluoromethyl)nitrobenzene | | CAS: | 6656-49-1 | | MF: | C8H6F3NO2 | | MW: | 205.13 | | EINECS: | 229-688-2 | | Product Categories: | Fluorine series;Trifluoromethylbenzene serise | | Mol File: | 6656-49-1.mol |  |
| | 2-Methyl-3-nitrobenzotrifluoride Chemical Properties |
| Boiling point | 86 °C | | density | 1.40 | | Fp | >100°C | | refractive index | 1.4780 | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Clear, faint yellow | | Sensitive | Light Sensitive | | BRN | 2457216 | | InChI | InChI=1S/C8H6F3NO2/c1-5-6(8(9,10)11)3-2-4-7(5)12(13)14/h2-4H,1H3 | | InChIKey | KQUQBPVYIURTNZ-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=CC=CC(C(F)(F)F)=C1C | | CAS DataBase Reference | 6656-49-1(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Methyl-3-nitrobenzotrifluoride(6656-49-1) |
| | 2-Methyl-3-nitrobenzotrifluoride Usage And Synthesis |
| Chemical Properties | Colorless to light yellow Liquid |
| | 2-Methyl-3-nitrobenzotrifluoride Preparation Products And Raw materials |
|