|
|
| | 6-Isopropyl-o-toluidine Basic information |
| Product Name: | 6-Isopropyl-o-toluidine | | Synonyms: | 2-AMINO-M-CYMENE;2-METHYL-6-ISOPROPYLANILINE;2-METHYL-6-(1-METHYLETHYL)BENZENAMINE;AKOS BBS-00003625;6-ISOPROPYL-2-METHYLANILINE;6-ISOPROPYL-O-TOLUIDINE;TIMTEC-BB SBB004080;2-ISOPROPYL-6-METHYLANILINE 95% | | CAS: | 5266-85-3 | | MF: | C10H15N | | MW: | 149.23 | | EINECS: | 226-083-5 | | Product Categories: | | | Mol File: | 5266-85-3.mol |  |
| | 6-Isopropyl-o-toluidine Chemical Properties |
| Boiling point | 231-232°C | | density | 0,957 g/cm3 | | refractive index | n20/D 1.544(lit.) | | Fp | 42°C | | storage temp. | 2-8°C, protect from light | | pka | 4.28±0.10(Predicted) | | form | liquid | | color | Orange | | InChI | InChI=1S/C10H15N/c1-7(2)9-6-4-5-8(3)10(9)11/h4-7H,11H2,1-3H3 | | InChIKey | DDTKYVBFPULMGN-UHFFFAOYSA-N | | SMILES | C1(N)=C(C(C)C)C=CC=C1C | | CAS DataBase Reference | 5266-85-3(CAS DataBase Reference) |
| | 6-Isopropyl-o-toluidine Usage And Synthesis |
| Chemical Properties | CLEAR RED TO BROWN LIQUID |
| | 6-Isopropyl-o-toluidine Preparation Products And Raw materials |
|