|
| 6-Isopropyl-o-toluidine Basic information |
Product Name: | 6-Isopropyl-o-toluidine | Synonyms: | 2-AMINO-M-CYMENE;2-METHYL-6-ISOPROPYLANILINE;2-METHYL-6-(1-METHYLETHYL)BENZENAMINE;2-ISOPROPYL-6-METHYLANILINE;AKOS BBS-00003625;6-ISOPROPYL-2-METHYLANILINE;6-ISOPROPYL-O-TOLUIDINE;TIMTEC-BB SBB004080 | CAS: | 5266-85-3 | MF: | C10H15N | MW: | 149.23 | EINECS: | 226-083-5 | Product Categories: | | Mol File: | 5266-85-3.mol |  |
| 6-Isopropyl-o-toluidine Chemical Properties |
Boiling point | 231-232°C | density | 0,957 g/cm3 | refractive index | n20/D 1.544(lit.) | Fp | 42°C | storage temp. | 2-8°C, protect from light | pka | 4.28±0.10(Predicted) | form | liquid | color | Orange | InChI | InChI=1S/C10H15N/c1-7(2)9-6-4-5-8(3)10(9)11/h4-7H,11H2,1-3H3 | InChIKey | DDTKYVBFPULMGN-UHFFFAOYSA-N | SMILES | C1(N)=C(C(C)C)C=CC=C1C | CAS DataBase Reference | 5266-85-3(CAS DataBase Reference) |
| 6-Isopropyl-o-toluidine Usage And Synthesis |
Chemical Properties | CLEAR RED TO BROWN LIQUID |
| 6-Isopropyl-o-toluidine Preparation Products And Raw materials |
|