|
|
| | Z-Arg-Leu-Arg-Gly-Gly-AMC Basic information |
| Product Name: | Z-Arg-Leu-Arg-Gly-Gly-AMC | | Synonyms: | Z-RLRGG-AMC;Glycinamide, N2-[(phenylmethoxy)carbonyl]-L-arginyl-L-leucyl-L-arginylglycyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-;Z-Arg-Leu-Arg-Gly-Gly-AMC (I-1690.0025);Z-RLRGG-AMC Acetate;Z-Arg-Leu-Arg-Gly-Gly-AMC acetate;N2-[(Phenylmethoxy)carbonyl]-L-arginyl-L-leucyl-L-arginylglycyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)glycinamide;Z-Arg-Leu-Arg-Gly-Gly-AMC | | CAS: | 167698-69-3 | | MF: | C40H56N12O9 | | MW: | 848.95 | | EINECS: | | | Product Categories: | ADC Linker | | Mol File: | 167698-69-3.mol |  |
| | Z-Arg-Leu-Arg-Gly-Gly-AMC Chemical Properties |
| density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: Sparingly Soluble: 1-10 mg/ml | | pka | 11.02±0.46(Predicted) | | form | film or powder | | color | white to beige | | Sequence | {Z}-Arg-Leu-Arg-Gly-Gly-{AMC} | | InChIKey | CMGDVBCGNGERLC-SZOHVZSOSA-N | | SMILES | FC(F)(F)C(=O)O.N([C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(=O)NCC(=O)Nc2cc3c(cc2)C(=CC(=O)O3)C)C(=O)OCc1ccccc1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Z-Arg-Leu-Arg-Gly-Gly-AMC Usage And Synthesis |
| Uses | Z-Arg-Leu-Arg-Gly-Gly-AMC is a peptide substrate of SARS-CoV PLpro[1]. | | Biological Activity | Z-RLRGG-AMC is a fluorogenic substrate for the MERS-CoV, SARS-CoV, SARS-CoV-2 papain-like protease (PLpros), deubiquitinating enzyme isopeptidase T (IPaseT) and other ubiquitin C-terminal hydrolases, which consists of the Ub and ISG15 C-terminal sequences. Z-RLRGG-AMC excitation wavelength is 340 nm, and emission wavelength is 460 nm. | | References | [1] Schalk F, et, al. GNPS-guided discovery of xylacremolide C and D, evaluation of their putative biosynthetic origin and bioactivity studies of xylacremolide A and B. RSC Adv. 2021 May 24;11(31):18748-18756. DOI:10.1039/d1ra00997d
[2] ROSS L. STEIN Francesco M Zhijian Chen. Kinetic studies of isopeptidase T: modulation of peptidase activity by ubiquitin[J]. Biochemistry Biochemistry, 1995, 34 39: 12616-12623. DOI: 10.1021/bi00039a017 |
| | Z-Arg-Leu-Arg-Gly-Gly-AMC Preparation Products And Raw materials |
|