|
|
| | 2-Chloro-5-fluorobenzoic acid Basic information |
| | 2-Chloro-5-fluorobenzoic acid Chemical Properties |
| Melting point | 147-149°C | | Boiling point | 275.3±20.0 °C(Predicted) | | density | 1.477±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 2.54±0.25(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C7H4ClFO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3H,(H,10,11) | | InChIKey | MIZKCMSSYVUZKD-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(F)=CC=C1Cl | | CAS DataBase Reference | 2252-50-8(CAS DataBase Reference) |
| | 2-Chloro-5-fluorobenzoic acid Usage And Synthesis |
| Chemical Properties | Light yellow powder |
| | 2-Chloro-5-fluorobenzoic acid Preparation Products And Raw materials |
|