|
|
| | 5-BROMO-1-METHYL-1H-IMIDAZOLE Basic information |
| | 5-BROMO-1-METHYL-1H-IMIDAZOLE Chemical Properties |
| Melting point | 40-44 °C (lit.) | | Boiling point | 120°C 15mm | | density | 1.69±0.1 g/cm3(Predicted) | | Fp | 180 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 5.25±0.10(Predicted) | | form | crystals | | color | Colourless/white | | InChI | InChI=1S/C4H5BrN2/c1-7-3-6-2-4(7)5/h2-3H,1H3 | | InChIKey | HATLLUIOEIXWGD-UHFFFAOYSA-N | | SMILES | C1N(C)C(Br)=CN=1 | | CAS DataBase Reference | 1003-21-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3335 | | WGK Germany | 3 | | Hazard Note | Irritant/Keep Cold | | HS Code | 29332900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-BROMO-1-METHYL-1H-IMIDAZOLE Usage And Synthesis |
| Chemical Properties | White to tan crystalline solid | | Uses | 5-Bromo-1-methyl-1H-imidazole is an ether that inhibits the farnesyltransferase enzyme. It also inhibits the activity of other enzymes such as dimethyl dioxan disulphide and alkylation inhibitors. |
| | 5-BROMO-1-METHYL-1H-IMIDAZOLE Preparation Products And Raw materials |
|