| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | 4-(4-Ethylpiperazin-1-ylmethyl)benzylamine Basic information |
| | 4-(4-Ethylpiperazin-1-ylmethyl)benzylamine Chemical Properties |
| Boiling point | 351.8±32.0 °C(Predicted) | | density | 1.039±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 9.19±0.10(Predicted) | | form | solid | | InChI | 1S/C14H23N3/c1-2-16-7-9-17(10-8-16)12-14-5-3-13(11-15)4-6-14/h3-6H,2,7-12,15H2,1H3 | | InChIKey | SAUDSDDZIRPWMO-UHFFFAOYSA-N | | SMILES | CCN1CCN(CC1)Cc2ccc(CN)cc2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-(4-Ethylpiperazin-1-ylmethyl)benzylamine Usage And Synthesis |
| | 4-(4-Ethylpiperazin-1-ylmethyl)benzylamine Preparation Products And Raw materials |
|