|
|
| | 4-NITROCINNAMALDEHYDE Basic information |
| Product Name: | 4-NITROCINNAMALDEHYDE | | Synonyms: | 3-(4-Nitro-phenyl)-propenal;4-nitrocinnamaldehyde, predominantly trans;(E)-3-(4-Nitrophenyl)-2-propenal;(E)-3-(4-Nitrophenyl)acrolein;(E)-4-Nitrocinnamaldehyde;(E)-p-Nitrocinnamaldehyde;(2E)-3-(4-Nitrophenyl)-2-propenal;trans-p-Nitrocinnamaldehyde | | CAS: | 49678-08-2 | | MF: | C9H7NO3 | | MW: | 177.16 | | EINECS: | 626-477-0 | | Product Categories: | Aldehydes;C9;Carbonyl Compounds | | Mol File: | 49678-08-2.mol |  |
| | 4-NITROCINNAMALDEHYDE Chemical Properties |
| Melting point | 140-143 °C(lit.) | | Boiling point | 311.6±17.0 °C(Predicted) | | density | 1.269±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | very faint turbidity in hot EtOH | | form | powder to crystal | | color | Light yellow to Brown to Dark green | | InChI | 1S/C9H7NO3/c11-7-1-2-8-3-5-9(6-4-8)10(12)13/h1-7H/b2-1+ | | InChIKey | ALGQVMMYDWQDEC-OWOJBTEDSA-N | | SMILES | [H]C(=O)\C=C\c1ccc(cc1)[N+]([O-])=O | | CAS DataBase Reference | 49678-08-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | GD6650000 | | HS Code | 2913000090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 4-NITROCINNAMALDEHYDE Usage And Synthesis |
| Uses | 4-Nitrocinnamaldehyde has been used in the preparation of 2, 2′-[(E)-3-(4-nitrophenyl) prop-2-ene-1,1-diyl] bis(3-hydroxy-5, 5-dimethylcyclohex-2-en-1-one). | | Synthesis Reference(s) | Tetrahedron Letters, 26, p. 6447, 1985 DOI: 10.1016/S0040-4039(00)99023-3 | | General Description | Reduction of trans-4-nitrocinnamaldehyde using the polymer-supported Hantzsch 1,4-dihydropyridine ester and a catalytic amount of HCl has been investigated. |
| | 4-NITROCINNAMALDEHYDE Preparation Products And Raw materials |
|