|
|
| | 4-ALLYLOXY-2-HYDROXYBENZOPHENONE Basic information |
| | 4-ALLYLOXY-2-HYDROXYBENZOPHENONE Chemical Properties |
| Melting point | 67-70 °C (lit.) | | Boiling point | 178°C/1mmHg(lit.) | | density | 1.165±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | pka | 7.63±0.35(Predicted) | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C16H14O3/c1-2-10-19-13-8-9-14(15(17)11-13)16(18)12-6-4-3-5-7-12/h2-9,11,17H,1,10H2 | | InChIKey | GVZIBGFELWPEOC-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(OCC=C)C=C1O)(C1=CC=CC=C1)=O | | EPA Substance Registry System | Methanone, [2-hydroxy-4-(2-propenyloxy)phenyl]phenyl- (2549-87-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29145090 |
| | 4-ALLYLOXY-2-HYDROXYBENZOPHENONE Usage And Synthesis |
| Uses | Copolymerizable UV absorber | | Preparation | Preparation by reaction of allyl chloride (3-chloro-propene) with resbenzophenone (90%). |
| | 4-ALLYLOXY-2-HYDROXYBENZOPHENONE Preparation Products And Raw materials |
|