|
|
| | METHYL 5-NITRO-2-FUROATE Basic information |
| | METHYL 5-NITRO-2-FUROATE Chemical Properties |
| Melting point | 78-82 °C (lit.) | | Boiling point | 301.06°C (rough estimate) | | density | 1.6529 (rough estimate) | | refractive index | 1.5423 (estimate) | | storage temp. | 2-8°C | | Appearance | light yellow solid | | BRN | 165132 | | InChI | 1S/C6H5NO5/c1-11-6(8)4-2-3-5(12-4)7(9)10/h2-3H,1H3 | | InChIKey | UTLKCGPAJUYGOM-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccc(o1)[N+]([O-])=O | | CAS DataBase Reference | 1874-23-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | RTECS | LV2013000 | | Hazard Note | Irritant | | HS Code | 29321900 | | Storage Class | 11 - Combustible Solids |
| | METHYL 5-NITRO-2-FUROATE Usage And Synthesis |
| Chemical Properties | yellowish crystalline powder | | Uses | Methyl 5-nitro-2-furoate may be used in the synthesis of 5-nitro-2-furoylhydrazine and 5-nitro-2-furamide. | | Definition | ChEBI: Methyl 5-nitro-2-furoate is a carboxylic ester. It is functionally related to a 2-furoic acid. | | General Description | Methyl 5-nitro-2-furoate is a nitrofuran derivative. Its density, freezing point and refractive index have been evaluated. The reduction of methyl 5-nitro-2-furoate using milk xanthine oxidase has been reported to form methyl 5-hydroxylamino-2-furoate and methyl 5-amino-2-furoate. The utility of methyl 5-nitro-2-furoate as a matrix compound for matrix assisted ionization vacuum (MAIV) has been assessed using bovine insulin as an analyte. |
| | METHYL 5-NITRO-2-FUROATE Preparation Products And Raw materials |
|