|
|
| | 3-Biphenylcarboxylic acid Basic information |
| Product Name: | 3-Biphenylcarboxylic acid | | Synonyms: | 3-Biphenylcarboxylic acid,97%;3-Biphenylcarboxylic acid3-Phenylbenzoic acid;3-Biphenylcarboxylic acid ,98%;Biphenyl-3-carboxylic acid 98+%;biphenyl-3-carboxylic acid(SALTDATA: FREE);3-Biphenylcarboxylic acid, 97% 1GR;3-Biphenylcarboxylic acid, 97% 5GR;Biphenyl-3-carboxylic Acid, 97+% | | CAS: | 716-76-7 | | MF: | C13H10O2 | | MW: | 198.22 | | EINECS: | 671-702-8 | | Product Categories: | Biphenyls | | Mol File: | 716-76-7.mol |  |
| | 3-Biphenylcarboxylic acid Chemical Properties |
| Melting point | 164-169 °C | | Boiling point | 107 °C(Press: 2 Torr) | | density | 1.185±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Crystalline Powder | | pka | 4.14±0.10(Predicted) | | color | Off-white to beige | | Water Solubility | Insoluble | | InChI | InChI=1S/C13H10O2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H,(H,14,15) | | InChIKey | XNLWJFYYOIRPIO-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=CC(C(O)=O)=C1 | | CAS DataBase Reference | 716-76-7(CAS DataBase Reference) |
| Provider | Language |
|
ACROS
| English |
| | 3-Biphenylcarboxylic acid Usage And Synthesis |
| Chemical Properties | off-white to beige crystalline powder | | Uses | 3-Biphenylcarboxylic Acid is a ortho-substituted biphenyl with inhibitory effect on glyceride synthesis. 3-Biphenylcarboxylic Acid is an anlogue of Diflusinal (D445751) and shows allosteric modulatory
effects. |
| | 3-Biphenylcarboxylic acid Preparation Products And Raw materials |
|