|
|
| | 3,4-Difluorobenzyl alcohol Basic information |
| | 3,4-Difluorobenzyl alcohol Chemical Properties |
| Boiling point | 101.45°C (rough estimate) | | density | 1.262 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.49(lit.) | | Fp | 208 °F | | storage temp. | Sealed in dry,Room Temperature | | pka | 13+-.0.10(Predicted) | | form | clear liquid | | color | Colorless to Red to Green | | Specific Gravity | 1.262 | | BRN | 9043426 | | InChI | InChI=1S/C7H6F2O/c8-6-2-1-5(4-10)3-7(6)9/h1-3,10H,4H2 | | InChIKey | GNQLTCVBSGVGHC-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=C(F)C(F)=C1 | | CAS DataBase Reference | 85118-05-4(CAS DataBase Reference) | | NIST Chemistry Reference | Benzenemethanol, 3,4-difluoro-(85118-05-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29062990 |
| | 3,4-Difluorobenzyl alcohol Usage And Synthesis |
| Chemical Properties | Clear colorless to very light yellow liquid |
| | 3,4-Difluorobenzyl alcohol Preparation Products And Raw materials |
|