| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Chloro-2-fluorobenzyl bromide Basic information |
| Product Name: | 3-Chloro-2-fluorobenzyl bromide | | Synonyms: | 3-CHLORO-2-FLUOROBENZYL BROMIDE;à-bromo-3-chloro-2-fluorotoluene;1-(bromomethyl)-3-chloro-2-fluorobenzene, 95+%;3-Chloro-2-fluorobenzyl bromide 97%;3-Chloro-2-fluorobenzylbromide97%;A-BROMO-2-FLUORO-3-CHLOROTOLUENE;3-CHLORO-2-FLUOROBENZYL BROMIDE 98+%;1-(Bromomethyl)-3-chloro-2-fluorobenzene, alpha-Bromo-3-chloro-2-fluorotoluene | | CAS: | 85070-47-9 | | MF: | C7H5BrClF | | MW: | 223.47 | | EINECS: | | | Product Categories: | Fluorine series;Aromatics;Miscellaneous Reagents | | Mol File: | 85070-47-9.mol |  |
| | 3-Chloro-2-fluorobenzyl bromide Chemical Properties |
| Melting point | <35°C | | Boiling point | 126 °C | | density | 1.654±0.06 g/cm3(Predicted) | | refractive index | 1.569 | | Fp | 125-126°C/15mm | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform, DMSO, Methanol | | form | Solid | | color | Pale Yellow | | FreezingPoint | 27.0 to 32.0 ℃ | | Sensitive | Lachrymatory | | InChI | InChI=1S/C7H5BrClF/c8-4-5-2-1-3-6(9)7(5)10/h1-3H,4H2 | | InChIKey | AQQPRCFCKCXWGZ-UHFFFAOYSA-N | | SMILES | C1(CBr)=CC=CC(Cl)=C1F | | CAS DataBase Reference | 85070-47-9(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Chloro-2-fluorobenzyl bromide(85070-47-9) |
| | 3-Chloro-2-fluorobenzyl bromide Usage And Synthesis |
| Chemical Properties | Pale Yellow Low Melting Solid | | Uses | 3-Chloro-2-fluorobenzyl Bromide (cas# 85070-47-9) is a compound useful in organic synthesis. |
| | 3-Chloro-2-fluorobenzyl bromide Preparation Products And Raw materials |
|