|
|
| | POLY(ISOBUTYL VINYL ETHER) Basic information |
| | POLY(ISOBUTYL VINYL ETHER) Chemical Properties |
| Boiling point | 60-140 °C | | density | 0.9 g/mL at 25 °C | | refractive index | n20/D 1.442 | | Fp | 52 °F | | Cosmetics Ingredients Functions | FILM FORMING | | InChI | InChI=1S/C6H12O/c1-4-7-5-6(2)3/h4,6H,1,5H2,2-3H3 | | InChIKey | OZCMOJQQLBXBKI-UHFFFAOYSA-N | | SMILES | C(OC=C)C(C)C | | EPA Substance Registry System | Propane, 1-(ethenyloxy)-2-methyl-, homopolymer (9003-44-5) |
| | POLY(ISOBUTYL VINYL ETHER) Usage And Synthesis |
| Chemical Properties | White, opaque elastomer or viscous liquid depending on molecular weight; almost odorless. Insoluble in water, ethanol, and acetone; soluble in most other organic solvents; stable toward dilute and concentrated alkalies and dilute acids. Compatible with a limited number of commercial resins, including rosin derivatives and some phenolics. Combustible. | | Uses | Poly (Isobutyl vinyl ether) is used as Adhesives, waxes, tackifiers, plasticizers, surface coatings, laminating agents, cable filling compositions, lubricating oils. |
| | POLY(ISOBUTYL VINYL ETHER) Preparation Products And Raw materials |
|