|
|
| | 4-Amino-5-ethylsulfonyl-2-methoxybenzoic acid Basic information |
| | 4-Amino-5-ethylsulfonyl-2-methoxybenzoic acid Chemical Properties |
| Melting point | 82-85°C | | Boiling point | 529.6±50.0 °C(Predicted) | | density | 1.390±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.09±0.10(Predicted) | | color | White to buff coloured powder | | Water Solubility | 8.555g/L at 25℃ | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C10H13NO5S/c1-3-17(14,15)9-4-6(10(12)13)8(16-2)5-7(9)11/h4-5H,3,11H2,1-2H3,(H,12,13) | | InChIKey | OJVNCXHGGYYOPH-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(S(CC)(=O)=O)=C(N)C=C1OC | | LogP | 0.46 | | CAS DataBase Reference | 71675-87-1(CAS DataBase Reference) |
| HazardClass | IRRITANT | | HS Code | 29225090 |
| | 4-Amino-5-ethylsulfonyl-2-methoxybenzoic acid Usage And Synthesis |
| Chemical Properties | Slightly Pink Solid | | Uses | An impurity found in amisulpride (A633250). Amisulpride EP Impurity E | | Flammability and Explosibility | Not classified | | Synthesis | The general procedure for the synthesis of 4-amino-5-(ethylsulfonyl)-2-methoxybenzoic acid using amisulpride impurity 4 as a starting material was as follows: 30% hydrogen peroxide was slowly added to isopropanol (4.84 L) at ambient temperature containing a catalytic amount of sodium tungstate (0.0082 kg) in 4-amino-2-methoxy-5-ethylthiomethyl benzoate (X) (1.21 kg) solution. The reaction mixture was stirred at 40-45 °C for 3-4 hours and subsequently cooled to 5-10 °C. To the reaction mixture, 5% sodium thiosulfate solution (0.06 kg dissolved in 18.15 L of water) was added and stirring was continued for 60 min to produce methyl 2-methoxy-4-amino-5-ethylsulfonylbenzoate (XI) in situ. Subsequently, sodium hydroxide (1.00 kg dissolved in 10 L of water) was added to the reaction mixture, warmed to 60-65 °C and stirred for 2-3 hours. Upon completion of the reaction, the reaction material was cooled and the pH was adjusted to 4.0-4.5 with dilute hydrochloric acid (1:10). the product was isolated by diafiltration in 82% yield and 99% purity. | | References | [1] Patent: WO2011/158084, 2011, A1. Location in patent: Page/Page column 12
[2] Patent: WO2011/158084, 2011, A1 |
| | 4-Amino-5-ethylsulfonyl-2-methoxybenzoic acid Preparation Products And Raw materials |
|