|
|
| | 2-Pyrrolidinemethanol, 4-fluoro-1-methyl-, (2S,4R)- Basic information |
| Product Name: | 2-Pyrrolidinemethanol, 4-fluoro-1-methyl-, (2S,4R)- | | Synonyms: | 2-Pyrrolidinemethanol, 4-fluoro-1-methyl-, (2S,4R)-;[(2S,4R)-4-fluoro-1-methyl-pyrrolidin-2-yl]methanol;(2S,4R)-4-Fluoro-1-methylpyrrolidine-2-methanol;(2S,4R)-N-methyl-4-fluoro-2-(hydroxymethyl)pyrrolidine;[(2S,4R)-4-fluoro-1-methyl-pyrrolidin-2-yl]methanol - [F85119] | | CAS: | 2206737-78-0 | | MF: | C6H12FNO | | MW: | 133.16 | | EINECS: | | | Product Categories: | | | Mol File: | 2206737-78-0.mol |  |
| | 2-Pyrrolidinemethanol, 4-fluoro-1-methyl-, (2S,4R)- Chemical Properties |
| storage temp. | 2-8°C, protect from light | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H12FNO/c1-8-3-5(7)2-6(8)4-9/h5-6,9H,2-4H2,1H3/t5-,6+/m1/s1 | | InChIKey | PVVBFPXFGPDGGN-RITPCOANSA-N | | SMILES | N1(C)C[C@H](F)C[C@H]1CO |
| | 2-Pyrrolidinemethanol, 4-fluoro-1-methyl-, (2S,4R)- Usage And Synthesis |
| | 2-Pyrrolidinemethanol, 4-fluoro-1-methyl-, (2S,4R)- Preparation Products And Raw materials |
|