|
|
| | 1H-Benzimidazole-6-carboxamide, 4-hydroxy-N,N,2-trimethyl-1-(phenylmethyl)- Basic information |
| Product Name: | 1H-Benzimidazole-6-carboxamide, 4-hydroxy-N,N,2-trimethyl-1-(phenylmethyl)- | | Synonyms: | 1H-Benzimidazole-6-carboxamide, 4-hydroxy-N,N,2-trimethyl-1-(phenylmethyl)-;4-Hydroxy-N,N,2-trimethyl-1-(phenylmethyl)-1H-Benzimidazole-6-carboxamide;Tegoprazan Impurity 6;1-benzyl-4-hydroxy-N,N,2-trimethyl-1H-benzo[d]imidazole-6-carboxyamide;LXI-15028-02;N-Bn Tegoprazan parent nucleus;Impurities generated by Tegola 42;Tegoprazan Impurities6 | | CAS: | 1640981-20-9 | | MF: | C18H19N3O2 | | MW: | 309.36 | | EINECS: | | | Product Categories: | | | Mol File: | 1640981-20-9.mol |  |
| | 1H-Benzimidazole-6-carboxamide, 4-hydroxy-N,N,2-trimethyl-1-(phenylmethyl)- Chemical Properties |
| Boiling point | 596.4±45.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 8.24±0.40(Predicted) | | Appearance | Off-white to pale purple Solid | | InChI | InChI=1S/C18H19N3O2/c1-12-19-17-15(21(12)11-13-7-5-4-6-8-13)9-14(10-16(17)22)18(23)20(2)3/h4-10,22H,11H2,1-3H3 | | InChIKey | DSXQCRAMTMAFGC-UHFFFAOYSA-N | | SMILES | C1(C)N(CC2=CC=CC=C2)C2=CC(C(N(C)C)=O)=CC(O)=C2N=1 |
| | 1H-Benzimidazole-6-carboxamide, 4-hydroxy-N,N,2-trimethyl-1-(phenylmethyl)- Usage And Synthesis |
| | 1H-Benzimidazole-6-carboxamide, 4-hydroxy-N,N,2-trimethyl-1-(phenylmethyl)- Preparation Products And Raw materials |
|