| Company Name: |
Shanghai Haohong Scientific Co., Ltd. Gold
|
| Tel: |
400-8210725 4008210725 |
| Email: |
malulu@leyan.com |
| Products Intro: |
Product Name:Ethyl 5-bromo-6-oxo-1,6-dihydropyridazine-3-carboxylate
CAS:2090927-90-3
Purity:98%
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:Ethyl 5-bromo-6-oxo-1,6-dihydropyridazine-3-carboxylate
CAS:2090927-90-3
Purity:98% Package:100mg;250mg;1g;5g Remarks:BD01602264
|
|
| | 3-Pyridazinecarboxylic acid, 5-bromo-1,6-dihydro-6-oxo-, ethyl ester Basic information |
| | 3-Pyridazinecarboxylic acid, 5-bromo-1,6-dihydro-6-oxo-, ethyl ester Chemical Properties |
| density | 1.77±0.1 g/cm3(Predicted) | | storage temp. | -20°C, sealed storage, away from moisture | | pka | 8.74±0.60(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C7H7BrN2O3/c1-2-13-7(12)5-3-4(8)6(11)10-9-5/h3H,2H2,1H3,(H,10,11) | | InChIKey | LRNXRVAADIJKCJ-UHFFFAOYSA-N | | SMILES | C1(C(OCC)=O)=NNC(=O)C(Br)=C1 |
| | 3-Pyridazinecarboxylic acid, 5-bromo-1,6-dihydro-6-oxo-, ethyl ester Usage And Synthesis |
| | 3-Pyridazinecarboxylic acid, 5-bromo-1,6-dihydro-6-oxo-, ethyl ester Preparation Products And Raw materials |
|