|
|
| | 6,6-Bis(4-carboxy-2-oxabutyl)-4,8-dioxaundecane-1, 11-dicarboxylic acid Basic information |
| Product Name: | 6,6-Bis(4-carboxy-2-oxabutyl)-4,8-dioxaundecane-1, 11-dicarboxylic acid | | Synonyms: | TETRAACID;3-[3-(2-carboxyethoxy)-2,2-bis(2-carboxyethoxymethyl)propoxy]propanoic acid;Propanoic acid, 3,3'-[[2,2-bis[(2-carboxyethoxy)methyl]-1,3-propanediyl]bis(oxy)]bis-;3,3'-((2,2-Bis((2-carboxyethoxy)methyl)propane-1,3-diyl)bis(oxy))dipropanoic acid;tetrakis(4-carboxy-2-oxabutyl)methane;PEPT-tetra(PEG1-acid);3,3'-((2,2-bis((2-carboxyethoxy)methyl)propane-1,3-diyl)bis(oxy))dipropionic acid;6,6-Bis(4-carboxy-2-oxabutyl)-4,8-dioxaundecane-1, 11-dicarboxylic acid | | CAS: | 35638-19-8 | | MF: | C17H28O12 | | MW: | 424.4 | | EINECS: | | | Product Categories: | Dendrimers;Dendron;Newkome Dendrimers | | Mol File: | Mol File |  |
| | 6,6-Bis(4-carboxy-2-oxabutyl)-4,8-dioxaundecane-1, 11-dicarboxylic acid Chemical Properties |
| Melting point | 98-101 °C(Solv: acetonitrile (75-05-8)) | | Boiling point | 710.3±60.0 °C(Predicted) | | density | 1.355±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.66±0.10(Predicted) | | form | solid | | color | White | | InChI | InChI=1S/C17H28O12/c18-13(19)1-5-26-9-17(10-27-6-2-14(20)21,11-28-7-3-15(22)23)12-29-8-4-16(24)25/h1-12H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25) | | InChIKey | KIGSIPUDIPIMRD-UHFFFAOYSA-N | | SMILES | C(OCCC(O)=O)C(COCCC(O)=O)(COCCC(O)=O)COCCC(O)=O |
| | 6,6-Bis(4-carboxy-2-oxabutyl)-4,8-dioxaundecane-1, 11-dicarboxylic acid Usage And Synthesis |
| Description | 1,3-bis(carboxyethoxy)-2,2-bis(carboxyethoxy)propane is a 4-branched molecule with carboxylic acid groupss to be conjugate with amino groups of other molecule or entity. | | Uses | 1,3-bis(carboxyethoxy)-2,2-bis(carboxyethoxy)propane is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | 6,6-Bis(4-carboxy-2-oxabutyl)-4,8-dioxaundecane-1, 11-dicarboxylic acid Preparation Products And Raw materials |
|