|
|
| | 1H-Pyrazole-1-acetamide, N-methyl-N-[2-(4-methylphenoxy)ethyl]-4-[(1-oxo-3-phenoxypropyl)amino]- Basic information |
| Product Name: | 1H-Pyrazole-1-acetamide, N-methyl-N-[2-(4-methylphenoxy)ethyl]-4-[(1-oxo-3-phenoxypropyl)amino]- | | Synonyms: | 1H-Pyrazole-1-acetamide, N-methyl-N-[2-(4-methylphenoxy)ethyl]-4-[(1-oxo-3-phenoxypropyl)amino]-;IXA4;N-[1-({methyl[2-(4-methylphenoxy)ethyl]carbamoy l}methyl)-1H-pyrazol-4-yl]-3-phenoxypropanamide;endoplasmic reticulum (ER) proteostasis,UPR,protein secretion,Inhibitor,Inositol requiring enzyme 1,IXA4,IXA-4,IRE1,unfolded protein response,IXA 4,inhibit;N-(1-(2-(methyl(2-(p-tolyloxy)ethyl)amino)-2-oxoethyl)-1H-pyrazol-4-yl)-3-phenoxypropanamide;IXA4, 10 mM in DMSO | | CAS: | 1185329-96-7 | | MF: | C24H28N4O4 | | MW: | 436.5 | | EINECS: | | | Product Categories: | | | Mol File: | 1185329-96-7.mol | ![1H-Pyrazole-1-acetamide, N-methyl-N-[2-(4-methylphenoxy)ethyl]-4-[(1-oxo-3-phenoxypropyl)amino]- Structure](CAS/20210111/GIF/1185329-96-7.gif) |
| | 1H-Pyrazole-1-acetamide, N-methyl-N-[2-(4-methylphenoxy)ethyl]-4-[(1-oxo-3-phenoxypropyl)amino]- Chemical Properties |
| Boiling point | 695.2±55.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO : 100 mg/mL (229.10 mM; Need ultrasonic) | | form | A solid | | pka | 13.84±0.70(Predicted) | | color | White to off-white | | InChI | 1S/C24H28N4O4/c1-19-8-10-22(11-9-19)32-15-13-27(2)24(30)18-28-17-20(16-25-28)26-23(29)12-14-31-21-6-4-3-5-7-21/h3-11,16-17H,12-15,18H2,1-2H3,(H,26,29) | | InChIKey | ZVSKMVAWWBSNOY-UHFFFAOYSA-N | | SMILES | O=C(CN1N=CC(NC(CCOC2=CC=CC=C2)=O)=C1)N(C)CCOC3=CC=C(C=C3)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1H-Pyrazole-1-acetamide, N-methyl-N-[2-(4-methylphenoxy)ethyl]-4-[(1-oxo-3-phenoxypropyl)amino]- Usage And Synthesis |
| Uses | IXA4 is a highly selective, non-toxic IRE1/XBP1s activator. IXA4 activates IRE1/XBP1s signaling without globally activating the unfolded protein response (UPR) or other stress-responsive signaling pathways (e.g., the heat shock response or oxidative stress response). IXA4 reduces secretion of APP through IRE1 activation[1]. | | Biological Activity | IXA4 is a nontoxic, potent and highly selective IRE1-XBP1s signaling activator th at induce ER proteostasis remodeling. IXA4 reduced Aβ levels and prevents APP-associated mitochondrial dysfunction in CHO7PA2 cells expressing the V717F APP (APPV717F) mutant. | | References | [1] Grandjean JMD, et al. Pharmacologic IRE1/XBP1s activation confers targeted ER proteostasis reprogramming. Nat Chem Biol. 2020;16(10):1052-1061. DOI:10.1038/s41589-020-0584-z |
| | 1H-Pyrazole-1-acetamide, N-methyl-N-[2-(4-methylphenoxy)ethyl]-4-[(1-oxo-3-phenoxypropyl)amino]- Preparation Products And Raw materials |
|