4-(2-METHOXYETHOXY)ANILINE manufacturers
|
| | 4-(2-METHOXYETHOXY)ANILINE Basic information |
| Product Name: | 4-(2-METHOXYETHOXY)ANILINE | | Synonyms: | 4-(2-methoxyethoxy)aniline(SALTDATA: HCl);4-(2-Methoxyethoxy)-benzenaMine;p-Phenetidine, β-methoxy-;4-(2-Methoxyethoxy);AKOS BC-2489;AKOS BBB/095;4-(2-METHOXYETHOXY)ANILINE;ASISCHEM C40525 | | CAS: | 33311-29-4 | | MF: | C9H13NO2 | | MW: | 167.21 | | EINECS: | | | Product Categories: | | | Mol File: | 33311-29-4.mol |  |
| | 4-(2-METHOXYETHOXY)ANILINE Chemical Properties |
| Boiling point | 142 °C(Press: 3 Torr) | | density | 1.078±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 5.10±0.10(Predicted) | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C9H13NO2/c1-11-6-7-12-9-4-2-8(10)3-5-9/h2-5H,6-7,10H2,1H3 | | InChIKey | DIOBEQCFVVJJBU-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(OCCOC)C=C1 |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2922290090 |
| | 4-(2-METHOXYETHOXY)ANILINE Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 4-(2-methoxyethoxy)aniline from 4-nitrophenyl-2-methoxyethyl ether: 1-(2-methoxyethoxy)-4-nitrobenzene (38) (3.9 g, 20 mmol), methanol (80 mL), and 10% activated carbon (400 mg) were added to a hydrogenation reactor. The reaction mixture was stirred overnight at room temperature in a hydrogen atmosphere. Upon completion of the reaction, the mixture was filtered through diatomaceous earth to remove the activated carbon. The filtrate was concentrated in vacuum to afford 4-(2-methoxyethoxy)aniline (39) (3.1 g, 93% yield) as a black oily product. m/z (M+1) 168.1 was shown by LC-MS (ESI) analysis. | | References | [1] Bioorganic and Medicinal Chemistry Letters, 2016, vol. 26, # 21, p. 5177 - 5181
[2] Patent: CN103864792, 2017, B. Location in patent: Paragraph 0313; 0314; 0315; 0316
[3] Patent: WO2015/131080, 2015, A1. Location in patent: Paragraph 00768; 00770
[4] Patent: WO2014/130693, 2014, A1. Location in patent: Paragraph 00544; 00547
[5] European Journal of Medicinal Chemistry, 1980, vol. 15, # 5, p. 399 - 404 |
| | 4-(2-METHOXYETHOXY)ANILINE Preparation Products And Raw materials |
|