| Company Name: |
Beijing Whale Technology Corporation Ltd. Gold
|
| Tel: |
010-83694934 13671295325 |
| Email: |
sales@whalecorporation.com |
| Products Intro: |
Product Name:3-Pyridinemethanol, 4-methoxy-6-methyl-2-(phenylmethoxy)-
CAS:1844851-15-5
Package:1kg;10kg;25kg
|
| Company Name: |
ShangHai Caerulum Pharma Discovery Co., Ltd.
|
| Tel: |
18149758185 18149758185 |
| Email: |
sales-cpd@caerulumpharma.com |
| Products Intro: |
Product Name:(2-(benzyloxy)-4-methoxy-6-methylpyridin-3-yl)methanol
CAS:1844851-15-5
Purity:98% Package:1g;10g;100g
|
| Company Name: |
ChengDu TongChuangYuan Pharmaceutical Co.Ltd
|
| Tel: |
028-83379370 13880556291 |
| Email: |
tcy@tcypharm.com |
| Products Intro: |
Product Name:4-Methoxy-6-methyl-2-(phenylmethoxy)-3-pyridinemethanol
CAS:1844851-15-5
Purity:99% HPLC Package:5KG;1KG
|
|
| | 3-Pyridinemethanol, 4-methoxy-6-methyl-2-(phenylmethoxy)- Basic information |
| Product Name: | 3-Pyridinemethanol, 4-methoxy-6-methyl-2-(phenylmethoxy)- | | Synonyms: | 3-Pyridinemethanol, 4-methoxy-6-methyl-2-(phenylmethoxy)-;(4-methoxy-6-methyl-2-phenylmethoxypyridin-3-yl)methanol;(2-benzyloxy-4-methoxy-6-methyl-3-pyridyl)methanol;4-Methoxy-6-methyl-2-(phenylmethoxy)-3-pyridinemethanol;(2-(benzyloxy)-4-methoxy-6-methylpyridin-3-yl)methanol | | CAS: | 1844851-15-5 | | MF: | C15H17NO3 | | MW: | 259.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1844851-15-5.mol |  |
| | 3-Pyridinemethanol, 4-methoxy-6-methyl-2-(phenylmethoxy)- Chemical Properties |
| Boiling point | 408.4±40.0 °C(Predicted) | | density | 1.170±0.06 g/cm3(Predicted) | | pka | 12.66±0.10(Predicted) | | InChI | InChI=1S/C15H17NO3/c1-11-8-14(18-2)13(9-17)15(16-11)19-10-12-6-4-3-5-7-12/h3-8,17H,9-10H2,1-2H3 | | InChIKey | KDNKSHYVQXHFMP-UHFFFAOYSA-N | | SMILES | C1(OCC2=CC=CC=C2)=NC(C)=CC(OC)=C1CO |
| | 3-Pyridinemethanol, 4-methoxy-6-methyl-2-(phenylmethoxy)- Usage And Synthesis |
| | 3-Pyridinemethanol, 4-methoxy-6-methyl-2-(phenylmethoxy)- Preparation Products And Raw materials |
|