| Company Name: |
GLP Pharma Standards
|
| Tel: |
+91 9866074638 |
| Email: |
info@glppharmastandards.com |
| Products Intro: |
Product Name:N-Nitroso Nortriptyline CAS:55855-42-0 Purity:NLT 95% Package:25 MG 50 MG 100 MG 250 MG EXTRA
|
| Company Name: |
Synchemia Research Chemical
|
| Tel: |
+91-9766925136 +91-7276018915 |
| Email: |
sales@synchemia.com |
| Products Intro: |
Product Name:N-Nitrosonortriptyline CAS:55855-42-0 Purity:99% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
1-Propanamine, 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-N-nitroso- manufacturers
|
| | 1-Propanamine, 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-N-nitroso- Basic information |
| Product Name: | 1-Propanamine, 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-N-nitroso- | | Synonyms: | 1-Propanamine, 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-N-nitroso-;N Nitroso Nortriptyline
Hydrochloride;Nortriptyline hydrochloride Impurity 11;Nortriptyline Impurity 26;Nortriptyline Impurity 26 (N-Nitroso Nortriptyline);N-Nitroso Nortriptyline (NNORT);N-(3-(10,11-Dihydro-5H-dibenzo[a,d][7]annulen-5-ylidene)propyl)-N-methylnitrous amide;N-Nitroso Nortriptyline Solution | | CAS: | 55855-42-0 | | MF: | C19H20N2O | | MW: | 292.37 | | EINECS: | | | Product Categories: | | | Mol File: | 55855-42-0.mol | ![1-Propanamine, 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-N-nitroso- Structure](CAS/20210305/GIF/55855-42-0.gif) |
| | 1-Propanamine, 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-N-nitroso- Chemical Properties |
| Boiling point | 480.3±24.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Thick Oil to Solid | | pka | -4.26±0.70(Predicted) | | color | Colourless to Pale Yellow | | Stability: | Light Sensitive | | InChI | InChI=1S/C19H20N2O/c1-21(20-22)14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19/h2-5,7-11H,6,12-14H2,1H3 | | InChIKey | HLXHGLYSNYJYEU-UHFFFAOYSA-N | | SMILES | C(N(C)N=O)C/C=C1/C2=CC=CC=C2CCC2=CC=CC=C2/1 |
| | 1-Propanamine, 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-N-nitroso- Usage And Synthesis |
| Uses | NтАРNitrosonortriptyline is an N-Nitroso derivative of Nortriptyline Hydrochloride(N837000), which is a tricyclic antidepressant. |
| | 1-Propanamine, 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-N-nitroso- Preparation Products And Raw materials |
|