| Company Name: |
Beijing HwrkChemical Technology Co., Ltd
|
| Tel: |
010-89508211 18501085097 |
| Email: |
sales.bj@hwrkchemical.com |
| Products Intro: |
Product Name:2-(4-Fluorophenyl)-5-methylpyridine
CAS:85237-65-6
Purity:98.00% Package:5g;1g;250mg
|
2-(4-FLUOROPHENYL)-5-METHYLPYRIDINE manufacturers
|
| | 2-(4-FLUOROPHENYL)-5-METHYLPYRIDINE Basic information |
| Product Name: | 2-(4-FLUOROPHENYL)-5-METHYLPYRIDINE | | Synonyms: | 2-(4-FLUOROPHENYL)-5-METHYLPYRIDINE;5-Methyl-2-(4-fluorophenyl)pyridine;Einecs 286-425-4;2-(4-Fluorophenyl)-5-methylpyridine, min. 97%;Pyridine, 2-(4-fluorophenyl)-5-methyl-;F-mppy;F-mppyH;p-F(Me)ppy | | CAS: | 85237-65-6 | | MF: | C12H10FN | | MW: | 187.21 | | EINECS: | 286-425-4 | | Product Categories: | | | Mol File: | 85237-65-6.mol |  |
| | 2-(4-FLUOROPHENYL)-5-METHYLPYRIDINE Chemical Properties |
| Melting point | 58-59 °C | | Boiling point | 285.6±25.0 °C(Predicted) | | density | 1.111±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.80±0.25(Predicted) | | form | powder or crystals | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H10FN/c1-9-2-7-12(14-8-9)10-3-5-11(13)6-4-10/h2-8H,1H3 | | InChIKey | WSVYYUKIXFSDTE-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(F)C=C2)=NC=C(C)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-(4-FLUOROPHENYL)-5-METHYLPYRIDINE Usage And Synthesis |
| Uses | 2-(4-Fluorophenyl)-5-methylpyridine is a ligand used for the preparation of Ir(III) photocatalysts. | | reaction suitability | reaction type: Photocatalysis
reagent type: catalyst |
| | 2-(4-FLUOROPHENYL)-5-METHYLPYRIDINE Preparation Products And Raw materials |
|