|
|
| | 2-Pyridinecarboxylic acid, 6-fluoro-3-hydroxy-, methyl ester Basic information |
| | 2-Pyridinecarboxylic acid, 6-fluoro-3-hydroxy-, methyl ester Chemical Properties |
| Boiling point | 377.1±42.0 °C(Predicted) | | density | 1.389±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under argon | | pka | 3.83±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H6FNO3/c1-12-7(11)6-4(10)2-3-5(8)9-6/h2-3,10H,1H3 | | InChIKey | XNEZPKIWTLEZGG-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=NC(F)=CC=C1O |
| | 2-Pyridinecarboxylic acid, 6-fluoro-3-hydroxy-, methyl ester Usage And Synthesis |
| | 2-Pyridinecarboxylic acid, 6-fluoro-3-hydroxy-, methyl ester Preparation Products And Raw materials |
|