|
|
| | (3-Methoxyphenyl)acetonitrile Basic information |
| | (3-Methoxyphenyl)acetonitrile Chemical Properties |
| Melting point | 8C | | Boiling point | 164-165 °C/20 mmHg (lit.) | | density | 1.054 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5402(lit.) | | Fp | 221 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol | | form | Liquid | | color | Clear colorless to slightly yellow | | Water Solubility | INSOLUBLE | | BRN | 1865539 | | Exposure limits | NIOSH: IDLH 25 mg/m3 | | InChI | InChI=1S/C9H9NO/c1-11-9-4-2-3-8(7-9)5-6-10/h2-4,7H,5H2,1H3 | | InChIKey | LXKNAUOWEJWGTE-UHFFFAOYSA-N | | SMILES | C1(CC#N)=CC=CC(OC)=C1 | | CAS DataBase Reference | 19924-43-7(CAS DataBase Reference) | | NIST Chemistry Reference | (3-Methoxyphenyl)acetonitrile(19924-43-7) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39-36 | | RIDADR | 3276 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269095 | | Storage Class | 10 - Combustible liquids |
| | (3-Methoxyphenyl)acetonitrile Usage And Synthesis |
| Chemical Properties | clear colorless to slightly yellow liquid | | Uses | 3-Methoxyphenylacetonitrile is used in the synthesis of isoflavones which inhibit epithelial cell proliferation and induce apoptosis in vitro. | | Uses | 3-Methoxyphenylacetonitrile was used in the synthesis of:
- new immunogen for homovanillic acid
- β,β′-cyclobisalkylated melatoninergic phenylalkylamides
- α-sec-butyl-3-methoxy phenylacetonitrile, antispasmodic agent
| | Definition | ChEBI: 2-(3-Methoxyphenyl)acetonitrile is a nitrile. |
| | (3-Methoxyphenyl)acetonitrile Preparation Products And Raw materials |
|