|
|
| | Carboxymethoxylamine hemihydrochloride Basic information |
| | Carboxymethoxylamine hemihydrochloride Chemical Properties |
| Melting point | 156 °C (dec.)(lit.) | | density | 1.7848 (rough estimate) | | refractive index | 1.6500 (estimate) | | storage temp. | 2-8°C | | solubility | DMF: 2mg/mL; DMSO: 5mg/mL; PBS (pH 7.2): 5mg/mL | | form | Crystalline Powder or Crystals | | color | White to off-white | | biological source | synthetic (organic) | | Water Solubility | decomposes | | BRN | 3680528 | | InChI | InChI=1S/2C2H5NO3.ClH/c2*3-6-1-2(4)5;/h2*1,3H2,(H,4,5);1H | | InChIKey | KBXIJIPYZKPDRU-UHFFFAOYSA-N | | SMILES | C(ON)C(=O)O.C(ON)C(=O)O.Cl | | EPA Substance Registry System | Acetic acid, (aminooxy)-, hydrochloride (2:1) (2921-14-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | AF3150000 | | F | 3 | | TSCA | TSCA listed | | HS Code | 29280000 | | Storage Class | 11 - Combustible Solids |
| | Carboxymethoxylamine hemihydrochloride Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder or crystals | | Uses | Carboxymethoxylamine hemihydrochloride is a bifunctional linking reagent that undergoes condensation with aldehydes and ketones to form oximes. It can also be used as a potent inhibitor of (pyridoxal 5’-phosphate) PLP-dependent β-lyases. | | Definition | ChEBI: (aminooxy)acetic acid hemihydrochloride is the hemihydrochloride salt of (aminooxy)acetic acid. It is a malate-aspartate shuttle (MAS) inhibitor which also inhibits the GABA degradating enzyme 4-aminobutyrate aminotransferase and cystathionine beta-synthetase. It contains an (aminooxy)acetate. | | Preparation | Carboxymethylhydroxylamine hemihydrochloride is obtained by reacting O-carboxymethylacetone oxime with hydrochloric acid. | | in vivo | The accumulation of GABA in cerebellum and whole brain is initially very rapid, being significantly increased already 5 min after the injection of Aminooxyacetic acid hemihydrochloride (AOAA). The rapid initial accumulation becomes gradually slower and maximal levels (400 to 600 % of the control levels) are reached 2 to 6 h after Aminooxyacetic acid hemihydrochloride. Still 24 h after Aminooxyacetic acid hemihydrochloride the GABA levels are elevated by about 250%. From 2 to 6 h after Aminooxyacetic acid hemihydrochloride the convulsions are completely blocked. Twenty four hours after Aminooxyacetic acid hemihydrochloride the convulsions are almost identical to the controls[2]. |
| | Carboxymethoxylamine hemihydrochloride Preparation Products And Raw materials |
|